Flacourtoside A
Internal ID | d4cc6740-f374-480e-b40e-ea7f5686c892 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl benzoate |
SMILES (Canonical) | C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)OC3=CC=C(C=C3)O)O)O)O |
SMILES (Isomeric) | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC=C(C=C3)O)O)O)O |
InChI | InChI=1S/C19H20O8/c20-12-6-8-13(9-7-12)26-19-17(23)16(22)15(21)14(27-19)10-25-18(24)11-4-2-1-3-5-11/h1-9,14-17,19-23H,10H2/t14-,15-,16+,17-,19-/m1/s1 |
InChI Key | ZNWJKOJJZQDPSW-OGJJZOIMSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H20O8 |
Molecular Weight | 376.40 g/mol |
Exact Mass | 376.11581759 g/mol |
Topological Polar Surface Area (TPSA) | 126.00 Ų |
XlogP | 0.40 |
SCHEMBL7150854 |
CHEMBL2036483 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.07% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.84% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.30% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.86% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.95% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.41% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.28% | 90.17% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.02% | 94.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.47% | 90.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.43% | 95.93% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.26% | 83.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.10% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 82.93% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.93% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.78% | 99.23% |
CHEMBL3891 | P07384 | Calpain 1 | 82.26% | 93.04% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.78% | 95.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Breynia vitis-idaea |
Protea eximia |
PubChem | 21672233 |
LOTUS | LTS0167555 |
wikiData | Q105380277 |