Fistulosaponin F
Internal ID | 2837073f-1997-4c7c-8d46-a9f302c36559 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2S)-4-[(1S,2S,4S,6R,7S,8R,9S,12S,13R,15R,16R)-16-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6,15-dihydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CC(C(C5)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)CO)O)O)O)O)C)C)OC1(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4(C[C@H]([C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O)C)C)O[C@@]1(CC[C@H](C)CO[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O |
InChI | InChI=1S/C51H84O25/c1-19(18-68-45-41(65)37(61)33(57)28(14-52)70-45)7-10-51(67)20(2)32-27(76-51)12-24-22-6-5-21-11-26(25(56)13-50(21,4)23(22)8-9-49(24,32)3)69-47-43(39(63)35(59)30(16-54)72-47)75-48-44(40(64)36(60)31(17-55)73-48)74-46-42(66)38(62)34(58)29(15-53)71-46/h5,19-20,22-48,52-67H,6-18H2,1-4H3/t19-,20-,22+,23-,24-,25+,26+,27-,28+,29+,30+,31+,32-,33+,34+,35+,36+,37-,38-,39-,40-,41+,42+,43+,44+,45+,46-,47+,48-,49-,50-,51+/m0/s1 |
InChI Key | JQGDCAZICJOHKT-SAIYXBACSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C51H84O25 |
Molecular Weight | 1097.20 g/mol |
Exact Mass | 1096.53016816 g/mol |
Topological Polar Surface Area (TPSA) | 407.00 Ų |
XlogP | -2.70 |
CHEMBL1163174 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.73% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.24% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.38% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.25% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.22% | 90.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.84% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.53% | 92.86% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.17% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.82% | 96.61% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.18% | 93.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.29% | 95.89% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.71% | 89.05% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.50% | 97.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.25% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.76% | 89.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.12% | 94.08% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.12% | 92.50% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 84.78% | 95.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.61% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.27% | 97.25% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.13% | 94.73% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.66% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.41% | 98.95% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.36% | 93.18% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 82.90% | 87.38% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.46% | 97.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.33% | 95.50% |
CHEMBL220 | P22303 | Acetylcholinesterase | 81.32% | 94.45% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.76% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium fistulosum |
PubChem | 46849836 |
LOTUS | LTS0040680 |
wikiData | Q105133471 |