Fisetinidol-4beta-ol
Internal ID | 552b729a-4bd5-4e71-9773-68f5b13923fa |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Leucoanthocyanidins |
IUPAC Name | (2R,3S,4S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7-triol |
SMILES (Canonical) | C1=CC(=C(C=C1C2C(C(C3=C(O2)C=C(C=C3)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1[C@@H]2[C@H]([C@H](C3=C(O2)C=C(C=C3)O)O)O)O)O |
InChI | InChI=1S/C15H14O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,13-20H/t13-,14-,15+/m0/s1 |
InChI Key | OFZBQQUVMQGHDJ-SOUVJXGZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H14O6 |
Molecular Weight | 290.27 g/mol |
Exact Mass | 290.07903816 g/mol |
Topological Polar Surface Area (TPSA) | 110.00 Ų |
XlogP | 0.70 |
967-30-6 |
5-Deoxyleucocyanidin |
(-)-Mollisacacidin |
Fisetinin-3,4-diol |
C09736 |
CHEBI:5067 |
SCHEMBL4740206 |
DTXSID30331819 |
LMPK12020178 |
Q27106639 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.17% | 91.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.19% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.72% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 86.73% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.70% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.21% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.03% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.03% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 84.68% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.89% | 94.73% |
CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 81.02% | 96.42% |
CHEMBL2581 | P07339 | Cathepsin D | 80.28% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.12% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acacia baileyana |
Acacia crombiei |
Acacia cultriformis |
Acacia fasciculifera |
Acacia longifolia |
Acacia mearnsii |
Acacia mollifolia |
Senegalia nigrescens |
Vachellia erioloba |
PubChem | 442398 |
LOTUS | LTS0093399 |
wikiData | Q27106639 |