[(2R,3S,4R,5R,6S)-6-[4-[[(3R,4R,5S)-5-[4-[(1S,2R)-2,3-dihydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)propoxy]-3,5-dimethoxyphenyl]-4-(hydroxymethyl)oxolan-3-yl]methyl]-2,6-dimethoxyphenoxy]-4,5-dihydroxy-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
| Internal ID | 45b5b6d0-4c98-4cc6-bbef-3192521358bf |
| Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-[4-[[(3R,4R,5S)-5-[4-[(1S,2R)-2,3-dihydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)propoxy]-3,5-dimethoxyphenyl]-4-(hydroxymethyl)oxolan-3-yl]methyl]-2,6-dimethoxyphenoxy]-4,5-dihydroxy-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES (Canonical) | COC1=CC(=CC(=C1OC2C(C(C(C(O2)COC(=O)C=CC3=CC(=C(C=C3)O)OC)OC(=O)C=CC4=CC(=C(C=C4)O)OC)O)O)OC)CC5COC(C5CO)C6=CC(=C(C(=C6)OC)OC(C7=CC(=C(C(=C7)OC)O)OC)C(CO)O)OC |
| SMILES (Isomeric) | COC1=CC(=CC(=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COC(=O)/C=C/C3=CC(=C(C=C3)O)OC)OC(=O)/C=C/C4=CC(=C(C=C4)O)OC)O)O)OC)C[C@H]5CO[C@@H]([C@H]5CO)C6=CC(=C(C(=C6)OC)O[C@@H](C7=CC(=C(C(=C7)OC)O)OC)[C@@H](CO)O)OC |
| InChI | InChI=1S/C59H68O24/c1-70-40-18-30(9-13-37(40)62)11-15-49(65)78-29-48-58(81-50(66)16-12-31-10-14-38(63)41(19-31)71-2)52(68)53(69)59(80-48)83-57-44(74-5)20-32(21-45(57)75-6)17-35-28-79-54(36(35)26-60)33-24-46(76-7)56(47(25-33)77-8)82-55(39(64)27-61)34-22-42(72-3)51(67)43(23-34)73-4/h9-16,18-25,35-36,39,48,52-55,58-64,67-69H,17,26-29H2,1-8H3/b15-11+,16-12+/t35-,36-,39+,48+,52+,53+,54+,55-,58+,59-/m0/s1 |
| InChI Key | NBVFZDCKZUKQGQ-DSPXHVMPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C59H68O24 |
| Molecular Weight | 1161.20 g/mol |
| Exact Mass | 1160.41005303 g/mol |
| Topological Polar Surface Area (TPSA) | 325.00 Ų |
| XlogP | 4.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.78% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.47% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.40% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.37% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.89% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.06% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.20% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.99% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.83% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.96% | 95.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.06% | 92.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.45% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.63% | 94.45% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.38% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.53% | 90.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.52% | 96.61% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.41% | 94.73% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 87.68% | 93.18% |
| CHEMBL204 | P00734 | Thrombin | 85.55% | 96.01% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.32% | 89.62% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.97% | 99.15% |
| CHEMBL3194 | P02766 | Transthyretin | 82.35% | 90.71% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.01% | 89.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.92% | 95.89% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 80.44% | 92.68% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Brucea javanica |
| PubChem | 163186850 |
| LOTUS | LTS0128536 |
| wikiData | Q105177013 |