4-(Furan-3-yl)-3,9,14,14,18-pentamethyl-7,10,20-trioxahexacyclo[15.2.1.03,8.06,8.09,19.013,18]icosane-11,15-dione
| Internal ID | f0802a4c-26d2-4c8c-b758-968973a978df |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
| IUPAC Name | 4-(furan-3-yl)-3,9,14,14,18-pentamethyl-7,10,20-trioxahexacyclo[15.2.1.03,8.06,8.09,19.013,18]icosane-11,15-dione |
| SMILES (Canonical) | CC1(C2CC(=O)OC3(C4C2(C(CC1=O)OC4CC5(C36C(O6)CC5C7=COC=C7)C)C)C)C |
| SMILES (Isomeric) | CC1(C2CC(=O)OC3(C4C2(C(CC1=O)OC4CC5(C36C(O6)CC5C7=COC=C7)C)C)C)C |
| InChI | InChI=1S/C26H32O6/c1-22(2)16-9-20(28)32-25(5)21-15(30-18(10-17(22)27)24(16,21)4)11-23(3)14(13-6-7-29-12-13)8-19-26(23,25)31-19/h6-7,12,14-16,18-19,21H,8-11H2,1-5H3 |
| InChI Key | XYFUPHKWDUUJGG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21988874 g/mol |
| Topological Polar Surface Area (TPSA) | 78.30 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
![2D Structure of 4-(Furan-3-yl)-3,9,14,14,18-pentamethyl-7,10,20-trioxahexacyclo[15.2.1.03,8.06,8.09,19.013,18]icosane-11,15-dione](https://plantaedb.com/storage/docs/compounds/2023/11/fcdbddc0-8575-11ee-a0e5-e70ff3d6a979.jpg "2D Structure of 4-(Furan-3-yl)-3,9,14,14,18-pentamethyl-7,10,20-trioxahexacyclo[15.2.1.03,8.06,8.09,19.013,18]icosane-11,15-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.36% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.20% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.74% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.42% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.36% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.94% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.05% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.63% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.06% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.63% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.69% | 89.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.58% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.41% | 97.14% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.82% | 93.40% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 81.68% | 92.51% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 81.44% | 95.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.27% | 85.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Toona ciliata |
| PubChem | 162948954 |
| LOTUS | LTS0059935 |
| wikiData | Q104953469 |