(2S,3S,4S,5R,6S)-6-[2-[4-[(2S,3R,4S,5S,6R)-6-(3-carboxypropanoyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-5-hydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid
Internal ID | 3d946bbf-ab86-4c35-9c42-92d7975997fc |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides > Flavonoid-7-O-glucuronides |
IUPAC Name | (2S,3S,4S,5R,6S)-6-[2-[4-[(2S,3R,4S,5S,6R)-6-(3-carboxypropanoyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-5-hydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)O)O)OC5C(C(C(C(O5)COC(=O)CCC(=O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)COC(=O)CCC(=O)O)O)O)O |
InChI | InChI=1S/C31H32O19/c32-14-7-13(47-31-27(42)24(39)25(40)28(50-31)29(43)44)8-17-21(14)15(33)9-16(48-17)11-1-3-12(4-2-11)46-30-26(41)23(38)22(37)18(49-30)10-45-20(36)6-5-19(34)35/h1-4,7-9,18,22-28,30-32,37-42H,5-6,10H2,(H,34,35)(H,43,44)/t18-,22-,23+,24+,25+,26-,27-,28+,30-,31-/m1/s1 |
InChI Key | KJWXNEVIHJTDHZ-WCIWHJIHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H32O19 |
Molecular Weight | 708.60 g/mol |
Exact Mass | 708.15377879 g/mol |
Topological Polar Surface Area (TPSA) | 306.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.50% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.44% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.57% | 89.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 95.41% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.85% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.07% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 92.65% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.33% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.84% | 94.00% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 91.16% | 83.57% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.03% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.93% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.37% | 94.73% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.25% | 95.78% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.03% | 86.92% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.64% | 94.45% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.93% | 91.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.79% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.98% | 85.14% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.94% | 83.82% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.75% | 90.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.56% | 91.19% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.32% | 95.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.50% | 92.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.76% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.02% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Centaurea cyanus |
PubChem | 102317646 |
LOTUS | LTS0190146 |
wikiData | Q105142025 |