[(2R,3R,4S,5S)-3-acetyloxy-4-[(E)-3-(4-acetyloxyphenyl)prop-2-enoyl]oxy-5-[[(E)-3-(4-acetyloxyphenyl)prop-2-enoyl]oxymethyl]-5-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate
Internal ID | d3946576-687e-4bce-9a84-af6ff25ad551 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters |
IUPAC Name | [(2R,3R,4S,5S)-3-acetyloxy-4-[(E)-3-(4-acetyloxyphenyl)prop-2-enoyl]oxy-5-[[(E)-3-(4-acetyloxyphenyl)prop-2-enoyl]oxymethyl]-5-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl (E)-3-(4-acetyloxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2(C(C(C(O2)COC(=O)C=CC3=CC=C(C=C3)OC(=O)C)OC(=O)C)OC(=O)C=CC4=CC=C(C=C4)OC(=O)C)COC(=O)C=CC5=CC=C(C=C5)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
SMILES (Isomeric) | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)O[C@]2([C@H]([C@@H]([C@H](O2)COC(=O)/C=C/C3=CC=C(C=C3)OC(=O)C)OC(=O)C)OC(=O)/C=C/C4=CC=C(C=C4)OC(=O)C)COC(=O)/C=C/C5=CC=C(C=C5)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
InChI | InChI=1S/C55H56O25/c1-30(56)67-27-44-49(73-34(5)60)51(75-36(7)62)52(76-37(8)63)54(77-44)80-55(29-69-47(65)25-16-39-11-20-42(21-12-39)71-32(3)58)53(78-48(66)26-17-40-13-22-43(23-14-40)72-33(4)59)50(74-35(6)61)45(79-55)28-68-46(64)24-15-38-9-18-41(19-10-38)70-31(2)57/h9-26,44-45,49-54H,27-29H2,1-8H3/b24-15+,25-16+,26-17+/t44-,45-,49+,50-,51+,52-,53+,54-,55+/m1/s1 |
InChI Key | ZSXALDGJPAPDLM-ZJAAGXPRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C55H56O25 |
Molecular Weight | 1117.00 g/mol |
Exact Mass | 1116.31106727 g/mol |
Topological Polar Surface Area (TPSA) | 317.00 Ų |
XlogP | 4.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.23% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.24% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.70% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 94.40% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.78% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.26% | 94.73% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 90.77% | 94.80% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.35% | 97.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.01% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.97% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.36% | 92.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.34% | 95.50% |
CHEMBL2581 | P07339 | Cathepsin D | 85.22% | 98.95% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 85.19% | 83.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.45% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.82% | 94.45% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.92% | 95.93% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.05% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Persicaria hydropiper |
PubChem | 163188596 |
LOTUS | LTS0031417 |
wikiData | Q105382776 |