7-[(2E,6E,10S)-10-hydroxy-3,7,11-trimethyl-11-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxydodeca-2,6-dienoxy]chromen-2-one
Internal ID | 01439a02-54e6-41c7-bbba-8680fd87421e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | 7-[(2E,6E,10S)-10-hydroxy-3,7,11-trimethyl-11-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxydodeca-2,6-dienoxy]chromen-2-one |
SMILES (Canonical) | CC(=CCCC(=CCOC1=CC2=C(C=C1)C=CC(=O)O2)C)CCC(C(C)(C)OC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | C/C(=C\CC/C(=C/COC1=CC2=C(C=C1)C=CC(=O)O2)/C)/CC[C@@H](C(C)(C)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C36H52O15/c1-19(6-5-7-20(2)14-15-46-22-11-9-21-10-13-27(39)48-23(21)16-22)8-12-26(38)36(3,4)51-35-33(45)31(43)29(41)25(50-35)18-47-34-32(44)30(42)28(40)24(17-37)49-34/h6,9-11,13-14,16,24-26,28-35,37-38,40-45H,5,7-8,12,15,17-18H2,1-4H3/b19-6+,20-14+/t24-,25-,26+,28-,29-,30+,31+,32-,33-,34-,35+/m1/s1 |
InChI Key | NTYBUFNMERIJCQ-OGDAMKPWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H52O15 |
Molecular Weight | 724.80 g/mol |
Exact Mass | 724.33062095 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | 1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.13% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.10% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 97.44% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.74% | 99.17% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 94.35% | 92.51% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.37% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.42% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.36% | 97.25% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 89.31% | 92.08% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.88% | 97.09% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 88.84% | 93.18% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.12% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.57% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.11% | 86.33% |
CHEMBL220 | P22303 | Acetylcholinesterase | 82.96% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.08% | 86.92% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.51% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.43% | 95.56% |
CHEMBL1907 | P15144 | Aminopeptidase N | 80.70% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ferula persica |
PubChem | 163189049 |
LOTUS | LTS0172919 |
wikiData | Q105185747 |