methyl (1S,4aS,8S,8aS)-8-hydroxy-8-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,8a-tetrahydro-1H-pyrano[3,4-c]pyran-4-carboxylate
Internal ID | 37e3a006-6bd7-4abd-a6c6-001f17fc2280 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | methyl (1S,4aS,8S,8aS)-8-hydroxy-8-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,8a-tetrahydro-1H-pyrano[3,4-c]pyran-4-carboxylate |
SMILES (Canonical) | CC1(C2C(CCO1)C(=COC2OC3C(C(C(C(O3)CO)O)O)O)C(=O)OC)O |
SMILES (Isomeric) | C[C@]1([C@H]2[C@H](CCO1)C(=CO[C@H]2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C(=O)OC)O |
InChI | InChI=1S/C17H26O11/c1-17(23)10-7(3-4-26-17)8(14(22)24-2)6-25-15(10)28-16-13(21)12(20)11(19)9(5-18)27-16/h6-7,9-13,15-16,18-21,23H,3-5H2,1-2H3/t7-,9-,10+,11-,12+,13-,15+,16+,17+/m1/s1 |
InChI Key | WHAPPFLYHSDHAN-JTZTUSFRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H26O11 |
Molecular Weight | 406.40 g/mol |
Exact Mass | 406.14751164 g/mol |
Topological Polar Surface Area (TPSA) | 164.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.43% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.01% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.53% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.88% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 88.22% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.12% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.78% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.28% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.80% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.35% | 99.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.30% | 92.50% |
CHEMBL5028 | O14672 | ADAM10 | 82.77% | 97.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.74% | 86.33% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.23% | 91.24% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.88% | 95.83% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.70% | 90.17% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.18% | 94.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.38% | 95.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.02% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lamium album |
PubChem | 163026641 |
LOTUS | LTS0148684 |
wikiData | Q105305191 |