[6-(Furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-9-en-14-yl] 2-methylbut-2-enoate
Internal ID | 26004461-3d06-47c0-99eb-b02076b02f0e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [6-(furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-9-en-14-yl] 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C2CC3C(CCC4(C3=CC(=O)OC4C5=COC=C5)C)C(C2=O)(C(C1(C)C)CC(=O)OC)C |
SMILES (Isomeric) | CC=C(C)C(=O)OC1C2CC3C(CCC4(C3=CC(=O)OC4C5=COC=C5)C)C(C2=O)(C(C1(C)C)CC(=O)OC)C |
InChI | InChI=1S/C32H40O8/c1-8-17(2)29(36)40-28-20-13-19-21(32(6,26(20)35)23(30(28,3)4)15-24(33)37-7)9-11-31(5)22(19)14-25(34)39-27(31)18-10-12-38-16-18/h8,10,12,14,16,19-21,23,27-28H,9,11,13,15H2,1-7H3 |
InChI Key | PASPCBBWRLTRED-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H40O8 |
Molecular Weight | 552.70 g/mol |
Exact Mass | 552.27231823 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 4.60 |
There are no found synonyms. |
![2D Structure of [6-(Furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-9-en-14-yl] 2-methylbut-2-enoate 2D Structure of [6-(Furan-3-yl)-16-(2-methoxy-2-oxoethyl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-9-en-14-yl] 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/fa583040-8729-11ee-a61b-0fe2f3d76966.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.84% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.66% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.32% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.76% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.82% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.98% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.80% | 85.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.61% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.49% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.20% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.93% | 91.19% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.50% | 99.23% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.22% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.67% | 95.89% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.58% | 93.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.37% | 90.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.74% | 95.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.73% | 91.07% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.78% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.01% | 90.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.36% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Entandrophragma angolense |
PubChem | 74321970 |
LOTUS | LTS0077558 |
wikiData | Q105204709 |