2-[(6,6-Dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methoxy]-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxane-3,4,5-triol
Internal ID | d0055e98-9465-4dc7-a08e-01b448ec4fa0 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | 2-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methoxy]-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxane-3,4,5-triol |
SMILES (Canonical) | CC1(C2CC=C(C1C2)COC3C(C(C(C(O3)COC4C(C(C(CO4)O)O)O)O)O)O)C |
SMILES (Isomeric) | CC1(C2CC=C(C1C2)COC3C(C(C(C(O3)COC4C(C(C(CO4)O)O)O)O)O)O)C |
InChI | InChI=1S/C21H34O10/c1-21(2)10-4-3-9(11(21)5-10)6-28-20-18(27)16(25)15(24)13(31-20)8-30-19-17(26)14(23)12(22)7-29-19/h3,10-20,22-27H,4-8H2,1-2H3 |
InChI Key | ZNYZPDGJGQZDPM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H34O10 |
Molecular Weight | 446.50 g/mol |
Exact Mass | 446.21519728 g/mol |
Topological Polar Surface Area (TPSA) | 158.00 Ų |
XlogP | -2.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.44% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.56% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.14% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.62% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.91% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.81% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.79% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.71% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.67% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.93% | 94.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.58% | 97.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.14% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rhodiola chrysanthemifolia subsp. sacra |
Rhodiola rosea |
PubChem | 78172846 |
LOTUS | LTS0203639 |
wikiData | Q105380305 |