N-[1-[(12R,13S,14R)-1,15-dihydroxy-3-methoxy-12-(4-methoxyphenyl)-13-phenyl-5,7,11-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-triene-14-carbonyl]pyrrolidin-2-yl]-3-methylbutanamide
Internal ID | cfc7ecb5-87ac-4156-9a3a-fdd8e104fc65 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 5-O-methylated flavonoids |
IUPAC Name | N-[1-[(12R,13S,14R)-1,15-dihydroxy-3-methoxy-12-(4-methoxyphenyl)-13-phenyl-5,7,11-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-triene-14-carbonyl]pyrrolidin-2-yl]-3-methylbutanamide |
SMILES (Canonical) | CC(C)CC(=O)NC1CCCN1C(=O)C2C(C3(C(C2(C4=C(C5=C(C=C4O3)OCO5)OC)O)O)C6=CC=C(C=C6)OC)C7=CC=CC=C7 |
SMILES (Isomeric) | CC(C)CC(=O)NC1CCCN1C(=O)[C@@H]2[C@H]([C@]3(C(C2(C4=C(C5=C(C=C4O3)OCO5)OC)O)O)C6=CC=C(C=C6)OC)C7=CC=CC=C7 |
InChI | InChI=1S/C36H40N2O9/c1-20(2)17-27(39)37-26-11-8-16-38(26)33(40)30-28(21-9-6-5-7-10-21)36(22-12-14-23(43-3)15-13-22)34(41)35(30,42)29-24(47-36)18-25-31(32(29)44-4)46-19-45-25/h5-7,9-10,12-15,18,20,26,28,30,34,41-42H,8,11,16-17,19H2,1-4H3,(H,37,39)/t26?,28-,30+,34?,35?,36+/m1/s1 |
InChI Key | ADLZFRJWHFEYCQ-FDYHJKDWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H40N2O9 |
Molecular Weight | 644.70 g/mol |
Exact Mass | 644.27338086 g/mol |
Topological Polar Surface Area (TPSA) | 136.00 Ų |
XlogP | 3.90 |
There are no found synonyms. |
![2D Structure of N-[1-[(12R,13S,14R)-1,15-dihydroxy-3-methoxy-12-(4-methoxyphenyl)-13-phenyl-5,7,11-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-triene-14-carbonyl]pyrrolidin-2-yl]-3-methylbutanamide 2D Structure of N-[1-[(12R,13S,14R)-1,15-dihydroxy-3-methoxy-12-(4-methoxyphenyl)-13-phenyl-5,7,11-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-triene-14-carbonyl]pyrrolidin-2-yl]-3-methylbutanamide](https://plantaedb.com/storage/docs/compounds/2023/11/f95a4da0-855f-11ee-bbe3-319fbb227aa8.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.73% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.92% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.33% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.30% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.86% | 95.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.99% | 96.77% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.83% | 85.14% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.83% | 93.99% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.26% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.90% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.36% | 92.62% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 91.82% | 99.18% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.56% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.96% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.55% | 90.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.93% | 97.14% |
CHEMBL204 | P00734 | Thrombin | 88.87% | 96.01% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.48% | 99.23% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.20% | 95.93% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.24% | 99.15% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.02% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.92% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.82% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.09% | 99.17% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.86% | 93.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.68% | 96.47% |
CHEMBL2535 | P11166 | Glucose transporter | 82.95% | 98.75% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.88% | 95.89% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.26% | 96.25% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.91% | 93.56% |
CHEMBL5028 | O14672 | ADAM10 | 80.69% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aglaia edulis |
PubChem | 102155085 |
LOTUS | LTS0096572 |
wikiData | Q104909668 |