2-[4,5-Dihydroxy-6-[[14-hydroxy-6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-2-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | e647851c-338e-4ed3-976b-2ff7ddb695f7 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4,5-dihydroxy-6-[[14-hydroxy-6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-2-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)C)O)O)O)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)OC |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)C)O)O)O)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)OC |
InChI | InChI=1S/C46H76O19/c1-19(18-59-41-37(55)35(53)33(51)28(16-47)62-41)9-12-46(58-6)20(2)31-27(65-46)15-26-24-8-7-22-13-23(14-30(49)45(22,5)25(24)10-11-44(26,31)4)61-43-39(57)36(54)40(29(17-48)63-43)64-42-38(56)34(52)32(50)21(3)60-42/h7,19-21,23-43,47-57H,8-18H2,1-6H3 |
InChI Key | QTFRXWHQGKUHJH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H76O19 |
Molecular Weight | 933.10 g/mol |
Exact Mass | 932.49808019 g/mol |
Topological Polar Surface Area (TPSA) | 296.00 Ų |
XlogP | -0.60 |
There are no found synonyms. |
![2D Structure of 2-[4,5-Dihydroxy-6-[[14-hydroxy-6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-2-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of 2-[4,5-Dihydroxy-6-[[14-hydroxy-6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-2-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/f800b830-8636-11ee-97d0-29c08c00754c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.81% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.77% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.54% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.00% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.67% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.26% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.46% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.13% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.80% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.41% | 86.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.96% | 94.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.91% | 95.89% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.89% | 92.86% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.75% | 93.56% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 86.22% | 98.05% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.60% | 96.43% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 85.50% | 98.46% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.96% | 94.08% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 84.01% | 91.65% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.54% | 97.33% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 83.18% | 95.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.53% | 100.00% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 82.36% | 92.38% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.10% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.33% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.31% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 81.22% | 97.50% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.56% | 100.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.26% | 94.23% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.01% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ruscus colchicus |
PubChem | 162919056 |
LOTUS | LTS0126924 |
wikiData | Q105227685 |