2-[[6-Hydroxy-15-[5-hydroxy-6-methyl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-7,7,12,16-tetramethyl-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-6-methyloxane-3,4,5-triol
Internal ID | e0108d5c-85a7-4d68-af4e-c14af53d5d49 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
IUPAC Name | 2-[[6-hydroxy-15-[5-hydroxy-6-methyl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-7,7,12,16-tetramethyl-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CC3C4(CC(C(C4(CCC35CC56C2C(C(CC6)O)(C)C)C)C(C)CCC(C(C)(C)OC7C(C(C(C(O7)CO)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2CC3C4(CC(C(C4(CCC35CC56C2C(C(CC6)O)(C)C)C)C(C)CCC(C(C)(C)OC7C(C(C(C(O7)CO)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)O)O)O |
InChI | InChI=1S/C48H82O19/c1-20(9-10-28(52)44(5,6)67-42-38(61)35(58)32(55)25(18-50)66-42)29-23(64-41-37(60)34(57)31(54)24(17-49)65-41)16-46(8)26-15-22(63-40-36(59)33(56)30(53)21(2)62-40)39-43(3,4)27(51)11-12-48(39)19-47(26,48)14-13-45(29,46)7/h20-42,49-61H,9-19H2,1-8H3 |
InChI Key | PYNNAAPVFOJBOV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H82O19 |
Molecular Weight | 963.20 g/mol |
Exact Mass | 962.54503038 g/mol |
Topological Polar Surface Area (TPSA) | 318.00 Ų |
XlogP | 0.30 |
Atomic LogP (AlogP) | -1.22 |
H-Bond Acceptor | 19 |
H-Bond Donor | 13 |
Rotatable Bonds | 13 |
There are no found synonyms. |
![2D Structure of 2-[[6-Hydroxy-15-[5-hydroxy-6-methyl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-7,7,12,16-tetramethyl-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-6-methyloxane-3,4,5-triol 2D Structure of 2-[[6-Hydroxy-15-[5-hydroxy-6-methyl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-7,7,12,16-tetramethyl-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/f7992ee0-7ef8-11ee-91c1-93b1575c0308.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.4805 | 48.05% |
Caco-2 | - | 0.8785 | 87.85% |
Blood Brain Barrier | - | 0.5750 | 57.50% |
Human oral bioavailability | - | 0.8857 | 88.57% |
Subcellular localzation | Mitochondria | 0.5846 | 58.46% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8590 | 85.90% |
OATP1B3 inhibitior | + | 0.9122 | 91.22% |
MATE1 inhibitior | - | 0.9800 | 98.00% |
OCT2 inhibitior | - | 0.5750 | 57.50% |
BSEP inhibitior | - | 0.7827 | 78.27% |
P-glycoprotein inhibitior | + | 0.7543 | 75.43% |
P-glycoprotein substrate | + | 0.5694 | 56.94% |
CYP3A4 substrate | + | 0.7172 | 71.72% |
CYP2C9 substrate | - | 0.8054 | 80.54% |
CYP2D6 substrate | - | 0.8164 | 81.64% |
CYP3A4 inhibition | - | 0.9472 | 94.72% |
CYP2C9 inhibition | - | 0.7996 | 79.96% |
CYP2C19 inhibition | - | 0.8391 | 83.91% |
CYP2D6 inhibition | - | 0.9505 | 95.05% |
CYP1A2 inhibition | - | 0.8918 | 89.18% |
CYP2C8 inhibition | + | 0.6270 | 62.70% |
CYP inhibitory promiscuity | - | 0.9671 | 96.71% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9700 | 97.00% |
Carcinogenicity (trinary) | Non-required | 0.6868 | 68.68% |
Eye corrosion | - | 0.9895 | 98.95% |
Eye irritation | - | 0.9033 | 90.33% |
Skin irritation | - | 0.7152 | 71.52% |
Skin corrosion | - | 0.9483 | 94.83% |
Ames mutagenesis | - | 0.6937 | 69.37% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7424 | 74.24% |
Micronuclear | - | 0.8000 | 80.00% |
Hepatotoxicity | - | 0.6718 | 67.18% |
skin sensitisation | - | 0.9113 | 91.13% |
Respiratory toxicity | - | 0.5000 | 50.00% |
Reproductive toxicity | + | 0.7444 | 74.44% |
Mitochondrial toxicity | - | 0.5875 | 58.75% |
Nephrotoxicity | - | 0.9008 | 90.08% |
Acute Oral Toxicity (c) | I | 0.6066 | 60.66% |
Estrogen receptor binding | + | 0.7125 | 71.25% |
Androgen receptor binding | + | 0.7566 | 75.66% |
Thyroid receptor binding | - | 0.5303 | 53.03% |
Glucocorticoid receptor binding | + | 0.6138 | 61.38% |
Aromatase binding | + | 0.6502 | 65.02% |
PPAR gamma | + | 0.7298 | 72.98% |
Honey bee toxicity | - | 0.6205 | 62.05% |
Biodegradation | - | 0.7250 | 72.50% |
Crustacea aquatic toxicity | - | 0.6600 | 66.00% |
Fish aquatic toxicity | + | 0.8024 | 80.24% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.73% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.38% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.05% | 97.09% |
CHEMBL240 | Q12809 | HERG | 96.30% | 89.76% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 95.03% | 95.58% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.48% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.90% | 96.61% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.89% | 96.21% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 91.88% | 92.50% |
CHEMBL2581 | P07339 | Cathepsin D | 90.91% | 98.95% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.55% | 97.79% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.96% | 92.86% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.84% | 98.05% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 88.41% | 97.64% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.94% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.82% | 95.89% |
CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 87.43% | 92.86% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 86.74% | 92.78% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.38% | 95.93% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 85.67% | 99.17% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 85.21% | 99.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.10% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.97% | 96.47% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.89% | 89.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.75% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.68% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.34% | 94.75% |
CHEMBL3837 | P07711 | Cathepsin L | 84.30% | 96.61% |
CHEMBL1741186 | P51449 | Nuclear receptor ROR-gamma | 84.18% | 99.17% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.06% | 90.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.67% | 86.33% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 83.67% | 95.38% |
CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 83.62% | 97.34% |
CHEMBL237 | P41145 | Kappa opioid receptor | 83.49% | 98.10% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.38% | 97.36% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.22% | 92.94% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.11% | 82.50% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.51% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.21% | 96.95% |
CHEMBL1977 | P11473 | Vitamin D receptor | 82.04% | 99.43% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.84% | 96.77% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.75% | 95.50% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 81.56% | 97.31% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.26% | 89.50% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.78% | 92.88% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.71% | 90.08% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 80.68% | 95.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.64% | 93.56% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.64% | 98.75% |
CHEMBL3589 | P55263 | Adenosine kinase | 80.43% | 98.05% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.43% | 97.14% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.15% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus amblolepis |
Fagopyrum esculentum |
PubChem | 163032085 |
LOTUS | LTS0257398 |
wikiData | Q105269036 |