7-[4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one
Internal ID | fb467ec8-1ee6-4ba4-bdf7-22455fcd4830 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 7-[4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC(=C(C=C5)OC)O)O)CO)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C([C@@H](O1)OC2C(C(C(OC2OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC(=C(C=C5)OC)O)O)CO)O)O)O)O)O |
InChI | InChI=1S/C28H34O15/c1-10-21(33)23(35)25(37)27(39-10)43-26-24(36)22(34)19(9-29)42-28(26)40-12-6-14(31)20-15(32)8-17(41-18(20)7-12)11-3-4-16(38-2)13(30)5-11/h3-7,10,17,19,21-31,33-37H,8-9H2,1-2H3/t10?,17?,19?,21?,22?,23?,24?,25?,26?,27-,28?/m0/s1 |
InChI Key | ARGKVCXINMKCAZ-HAXTVYHKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H34O15 |
Molecular Weight | 610.60 g/mol |
Exact Mass | 610.18977037 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | -0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.23% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.20% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.93% | 94.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.29% | 96.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.03% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 93.98% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.98% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.94% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.66% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.18% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.90% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.05% | 97.36% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.28% | 86.92% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.78% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.03% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.49% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.36% | 94.45% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.96% | 95.78% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.45% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.00% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.90% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.45% | 99.23% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.30% | 94.80% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.86% | 97.53% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.02% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Carpobrotus edulis |
Citrus × aurantium |
Citrus latipes |
Citrus maxima |
Citrus medica |
Uncaria hirsuta |
PubChem | 138107793 |
LOTUS | LTS0014248 |
wikiData | Q104390645 |