2-[[6-[4,5-Dihydroxy-2-(hydroxymethyl)-6-[[6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-3-yl]oxy-3,4-dihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 3120ac71-c6a2-47ea-b278-36c5f90b2d08 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[[6-[4,5-dihydroxy-2-(hydroxymethyl)-6-[[6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-3-yl]oxy-3,4-dihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)COC8C(C(C(C(O8)CO)O)O)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)C)C)OC1(CCC(C)COC1C(C(C(C(O1)CO)O)O)O)OC |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)COC8C(C(C(C(O8)CO)O)O)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)C)C)OC1(CCC(C)COC1C(C(C(C(O1)CO)O)O)O)OC |
InChI | InChI=1S/C58H98O29/c1-22(20-77-51-45(72)40(67)36(63)30(16-59)80-51)8-13-58(76-5)23(2)35-29(87-58)15-28-26-7-6-24-14-25(9-11-56(24,3)27(26)10-12-57(28,35)4)79-53-48(75)44(71)49(33(19-62)83-53)85-55-50(86-54-47(74)42(69)38(65)32(18-61)82-54)43(70)39(66)34(84-55)21-78-52-46(73)41(68)37(64)31(17-60)81-52/h22-55,59-75H,6-21H2,1-5H3 |
InChI Key | SFMHJDIJYHLIGE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H98O29 |
Molecular Weight | 1259.40 g/mol |
Exact Mass | 1258.61937708 g/mol |
Topological Polar Surface Area (TPSA) | 455.00 Ų |
XlogP | -3.00 |
There are no found synonyms. |
![2D Structure of 2-[[6-[4,5-Dihydroxy-2-(hydroxymethyl)-6-[[6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-3-yl]oxy-3,4-dihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of 2-[[6-[4,5-Dihydroxy-2-(hydroxymethyl)-6-[[6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-3-yl]oxy-3,4-dihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/f691abf0-85f6-11ee-976e-47a7cc0b2867.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.57% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.49% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.22% | 97.09% |
CHEMBL237 | P41145 | Kappa opioid receptor | 94.57% | 98.10% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.51% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.21% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.31% | 94.45% |
CHEMBL233 | P35372 | Mu opioid receptor | 92.99% | 97.93% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.89% | 95.93% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.33% | 92.86% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.31% | 89.05% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 91.32% | 98.05% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 91.15% | 93.18% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.11% | 96.21% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 90.36% | 97.79% |
CHEMBL1871 | P10275 | Androgen Receptor | 90.27% | 96.43% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.51% | 100.00% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 87.87% | 95.36% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.46% | 97.29% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.82% | 92.98% |
CHEMBL220 | P22303 | Acetylcholinesterase | 86.66% | 94.45% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 86.66% | 92.38% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.53% | 96.47% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.75% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.50% | 95.50% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.17% | 95.58% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.15% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.13% | 92.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.00% | 95.89% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.30% | 98.46% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 83.97% | 97.64% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 82.19% | 97.86% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.89% | 92.94% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.81% | 100.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.70% | 97.50% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.24% | 92.32% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 80.82% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.46% | 96.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Yucca filamentosa |
PubChem | 162962007 |
LOTUS | LTS0185322 |
wikiData | Q105251868 |