[2,3-dihydroxy-5-[[(2R,3R,4R,5R,6S)-3,4,5,6-tetrakis[[3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoyl]oxy]oxan-2-yl]methoxycarbonyl]phenyl] 3,4,5-trihydroxybenzoate
Internal ID | a45bf5b9-814a-4a31-aad4-51eaab5efa06 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [2,3-dihydroxy-5-[[(2R,3R,4R,5R,6S)-3,4,5,6-tetrakis[[3,4-dihydroxy-5-(3,4,5-trihydroxybenzoyl)oxybenzoyl]oxy]oxan-2-yl]methoxycarbonyl]phenyl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OC[C@@H]3[C@H]([C@H]([C@H]([C@@H](O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O |
InChI | InChI=1S/C76H52O46/c77-32-1-22(2-33(78)53(32)92)67(103)113-47-16-27(11-42(87)58(47)97)66(102)112-21-52-63(119-72(108)28-12-43(88)59(98)48(17-28)114-68(104)23-3-34(79)54(93)35(80)4-23)64(120-73(109)29-13-44(89)60(99)49(18-29)115-69(105)24-5-36(81)55(94)37(82)6-24)65(121-74(110)30-14-45(90)61(100)50(19-30)116-70(106)25-7-38(83)56(95)39(84)8-25)76(118-52)122-75(111)31-15-46(91)62(101)51(20-31)117-71(107)26-9-40(85)57(96)41(86)10-26/h1-20,52,63-65,76-101H,21H2/t52-,63-,64-,65-,76+/m1/s1 |
InChI Key | LRBQNJMCXXYXIU-JPZKJCTESA-N |
Popularity | 0 references in papers |
Molecular Formula | C76H52O46 |
Molecular Weight | 1701.20 g/mol |
Exact Mass | 1700.1729741 g/mol |
Topological Polar Surface Area (TPSA) | 778.00 Ų |
XlogP | 6.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1287622 | Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 |
100 nM |
Potency |
via Super-PRED
|
CHEMBL1835 | P24557 | Thromboxane-A synthase |
325 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.08% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 97.17% | 83.00% |
CHEMBL3194 | P02766 | Transthyretin | 93.50% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.33% | 96.09% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.41% | 95.64% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.27% | 99.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.07% | 96.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.53% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.86% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.94% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.86% | 94.73% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.56% | 92.50% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.82% | 95.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.23% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 80.47% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.08% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Achillea millefolium |
Coffea arabica |
PubChem | 134129492 |
LOTUS | LTS0271868 |
wikiData | Q104375818 |