[1-[2-Acetyloxy-5-(3,3-dimethyloxiran-2-yl)oxolan-3-yl]-3b,6,6,10a,12a-pentamethyl-8-oxo-1,2,4,5,5a,10b,11,12-octahydroindeno[5,4-g][2]benzoxepin-4-yl] acetate
| Internal ID | 6946ca5b-b0c1-4177-92a9-76546f633b3a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
| IUPAC Name | [1-[2-acetyloxy-5-(3,3-dimethyloxiran-2-yl)oxolan-3-yl]-3b,6,6,10a,12a-pentamethyl-8-oxo-1,2,4,5,5a,10b,11,12-octahydroindeno[5,4-g][2]benzoxepin-4-yl] acetate |
| SMILES (Canonical) | CC(=O)OC1CC2C(OC(=O)C=CC2(C3C1(C4=CCC(C4(CC3)C)C5CC(OC5OC(=O)C)C6C(O6)(C)C)C)C)(C)C |
| SMILES (Isomeric) | CC(=O)OC1CC2C(OC(=O)C=CC2(C3C1(C4=CCC(C4(CC3)C)C5CC(OC5OC(=O)C)C6C(O6)(C)C)C)C)(C)C |
| InChI | InChI=1S/C34H48O8/c1-18(35)38-26-17-25-30(3,4)41-27(37)13-15-33(25,8)24-12-14-32(7)21(10-11-23(32)34(24,26)9)20-16-22(28-31(5,6)42-28)40-29(20)39-19(2)36/h11,13,15,20-22,24-26,28-29H,10,12,14,16-17H2,1-9H3 |
| InChI Key | XGTURGCXRFTNTO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C34H48O8 |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.33491849 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
![2D Structure of [1-[2-Acetyloxy-5-(3,3-dimethyloxiran-2-yl)oxolan-3-yl]-3b,6,6,10a,12a-pentamethyl-8-oxo-1,2,4,5,5a,10b,11,12-octahydroindeno[5,4-g][2]benzoxepin-4-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/f5e64790-83f2-11ee-b920-1d00c9065d04.jpg "2D Structure of [1-[2-Acetyloxy-5-(3,3-dimethyloxiran-2-yl)oxolan-3-yl]-3b,6,6,10a,12a-pentamethyl-8-oxo-1,2,4,5,5a,10b,11,12-octahydroindeno[5,4-g][2]benzoxepin-4-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.10% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.20% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.18% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.29% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.73% | 85.14% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.14% | 94.75% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.64% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.02% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.28% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.83% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.44% | 97.09% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.43% | 93.04% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.12% | 97.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.53% | 94.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.44% | 97.28% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.27% | 91.24% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.03% | 94.73% |
| CHEMBL5028 | O14672 | ADAM10 | 80.18% | 97.50% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.15% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Luvunga sarmentosa |
| PubChem | 163002686 |
| LOTUS | LTS0077812 |
| wikiData | Q105327809 |