7-hydroxy-7-methyl-1-[[3,4,5-trihydroxy-6-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]methoxy]-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carbaldehyde
| Internal ID | 1252dcf5-3f8b-4dc0-8db9-79ded79c7297 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Iridoids and derivatives |
| IUPAC Name | 7-hydroxy-7-methyl-1-[[3,4,5-trihydroxy-6-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]methoxy]-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carbaldehyde |
| SMILES (Canonical) | CC1(CCC2C1C(OC=C2C=O)OCC3C(C(C(C(O3)OC4C(C(C(OC4O)CO)O)O)O)O)O)O |
| SMILES (Isomeric) | CC1(CCC2C1C(OC=C2C=O)OCC3C(C(C(C(O3)OC4C(C(C(OC4O)CO)O)O)O)O)O)O |
| InChI | InChI=1S/C22H34O14/c1-22(31)3-2-9-8(4-23)6-32-20(12(9)22)33-7-11-14(26)15(27)17(29)21(35-11)36-18-16(28)13(25)10(5-24)34-19(18)30/h4,6,9-21,24-31H,2-3,5,7H2,1H3 |
| InChI Key | WILPSDUESCCQEW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H34O14 |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.19485575 g/mol |
| Topological Polar Surface Area (TPSA) | 225.00 Ų |
| XlogP | -4.20 |
| There are no found synonyms. |
![2D Structure of 7-hydroxy-7-methyl-1-[[3,4,5-trihydroxy-6-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]methoxy]-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/f5bdee00-8578-11ee-ac09-2ba2730eaf02.jpg "2D Structure of 7-hydroxy-7-methyl-1-[[3,4,5-trihydroxy-6-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxyoxan-2-yl]methoxy]-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carbaldehyde")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.49% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.75% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.93% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.53% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.30% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.38% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.88% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.30% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.89% | 86.33% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.18% | 86.92% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.58% | 95.50% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.40% | 95.83% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.38% | 98.95% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.83% | 92.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.69% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.47% | 90.00% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.54% | 83.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pedicularis plicata |
| PubChem | 163038473 |
| LOTUS | LTS0127399 |
| wikiData | Q105306349 |