(2R)-2-[2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-7-one
Internal ID | 9cd88a6c-ce38-4648-94ce-712af1ced480 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Furanocoumarins > Psoralens |
IUPAC Name | (2R)-2-[2-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-7-one |
SMILES (Canonical) | CC(C)(C1CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | CC(C)([C@H]1CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)O[C@H]4[C@@H]([C@H]([C@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C20H24O9/c1-20(2,29-19-18(25)17(24)16(23)13(8-21)28-19)14-6-10-5-9-3-4-15(22)27-11(9)7-12(10)26-14/h3-5,7,13-14,16-19,21,23-25H,6,8H2,1-2H3/t13-,14-,16+,17+,18-,19+/m1/s1 |
InChI Key | HXCGUCZXPFBNRD-QVYYAULWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H24O9 |
Molecular Weight | 408.40 g/mol |
Exact Mass | 408.14203234 g/mol |
Topological Polar Surface Area (TPSA) | 135.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.80% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.53% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.17% | 97.25% |
CHEMBL220 | P22303 | Acetylcholinesterase | 94.98% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.67% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.32% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.42% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.60% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.01% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.48% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.75% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.42% | 99.17% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.90% | 95.83% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.76% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Angelica gigas |
Rhodiola rosea |
PubChem | 154497099 |
LOTUS | LTS0138059 |
wikiData | Q105034916 |