[(1S,2S,4S,7R,9R,13S,14R,16S,17S)-4-benzoyloxy-15-methoxy-2,14,17-trimethyl-3,11-dioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadecan-16-yl] 1,3-benzodioxole-5-carboxylate
Internal ID | e24547c5-f552-45c9-b797-da8f04522ab9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Quassinoids |
IUPAC Name | [(1S,2S,4S,7R,9R,13S,14R,16S,17S)-4-benzoyloxy-15-methoxy-2,14,17-trimethyl-3,11-dioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadecan-16-yl] 1,3-benzodioxole-5-carboxylate |
SMILES (Canonical) | CC1C2CC(=O)OC3C2(C(C(C1OC)OC(=O)C4=CC5=C(C=C4)OCO5)C6(C(C3)CCC(C6=O)OC(=O)C7=CC=CC=C7)C)C |
SMILES (Isomeric) | C[C@@H]1[C@@H]2CC(=O)O[C@H]3[C@@]2([C@H]([C@@H](C1OC)OC(=O)C4=CC5=C(C=C4)OCO5)[C@@]6([C@@H](C3)CC[C@@H](C6=O)OC(=O)C7=CC=CC=C7)C)C |
InChI | InChI=1S/C35H38O10/c1-18-22-16-27(36)44-26-15-21-11-13-24(43-32(38)19-8-6-5-7-9-19)31(37)34(21,2)30(35(22,26)3)29(28(18)40-4)45-33(39)20-10-12-23-25(14-20)42-17-41-23/h5-10,12,14,18,21-22,24,26,28-30H,11,13,15-17H2,1-4H3/t18-,21-,22+,24+,26-,28?,29-,30-,34+,35-/m1/s1 |
InChI Key | UHCBSYPZCNOULX-GBPNZQBXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H38O10 |
Molecular Weight | 618.70 g/mol |
Exact Mass | 618.24649740 g/mol |
Topological Polar Surface Area (TPSA) | 124.00 Ų |
XlogP | 5.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.89% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.83% | 86.33% |
CHEMBL240 | Q12809 | HERG | 97.54% | 89.76% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.64% | 91.11% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.81% | 94.80% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.41% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.23% | 99.23% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 91.52% | 83.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.03% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.57% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.11% | 91.19% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.40% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 87.39% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.54% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.05% | 92.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.64% | 95.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.80% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.51% | 95.89% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 84.13% | 91.43% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.13% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.01% | 96.77% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 83.59% | 82.38% |
CHEMBL5028 | O14672 | ADAM10 | 82.71% | 97.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.26% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Picrasma javanica |
PubChem | 101046541 |
LOTUS | LTS0021901 |
wikiData | Q105272702 |