(2S)-4-[(13R)-13-[(2S,3R,5R)-5-[(2R,5R)-5-[(1S,5S)-1,5-dihydroxyundecyl]oxolan-2-yl]-3-hydroxyoxolan-2-yl]-13-hydroxytridecyl]-2-methyl-2H-furan-5-one
Internal ID | 2cc091e5-88f1-4567-8077-c226eca254d6 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Annonaceous acetogenins |
IUPAC Name | (2S)-4-[(13R)-13-[(2S,3R,5R)-5-[(2R,5R)-5-[(1S,5S)-1,5-dihydroxyundecyl]oxolan-2-yl]-3-hydroxyoxolan-2-yl]-13-hydroxytridecyl]-2-methyl-2H-furan-5-one |
SMILES (Canonical) | CCCCCCC(CCCC(C1CCC(O1)C2CC(C(O2)C(CCCCCCCCCCCCC3=CC(OC3=O)C)O)O)O)O |
SMILES (Isomeric) | CCCCCC[C@@H](CCC[C@@H]([C@H]1CC[C@@H](O1)[C@H]2C[C@H]([C@@H](O2)[C@@H](CCCCCCCCCCCCC3=C[C@@H](OC3=O)C)O)O)O)O |
InChI | InChI=1S/C37H66O8/c1-3-4-5-15-19-29(38)20-17-22-30(39)33-23-24-34(44-33)35-26-32(41)36(45-35)31(40)21-16-13-11-9-7-6-8-10-12-14-18-28-25-27(2)43-37(28)42/h25,27,29-36,38-41H,3-24,26H2,1-2H3/t27-,29-,30-,31+,32+,33+,34+,35+,36-/m0/s1 |
InChI Key | ZYUXJOCCSWDREX-ZIJWQAAMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H66O8 |
Molecular Weight | 638.90 g/mol |
Exact Mass | 638.47576906 g/mol |
Topological Polar Surface Area (TPSA) | 126.00 Ų |
XlogP | 9.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.39% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.76% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 97.25% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.67% | 91.11% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 93.59% | 85.94% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 91.53% | 89.63% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 90.67% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.61% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.66% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.65% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.55% | 97.09% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.55% | 92.86% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.53% | 94.73% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.55% | 95.58% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.89% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.49% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.16% | 95.89% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.76% | 83.82% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.97% | 89.00% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 81.80% | 80.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.43% | 99.17% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 81.33% | 92.08% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.04% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona squamosa |
PubChem | 162906434 |
LOTUS | LTS0056799 |
wikiData | Q105386450 |