methyl (4S,5E,6S)-5-ethylidene-4-[2-[[(2R,3R,4S,5R,6R)-4-[2-[(2S,3E,4S)-3-ethylidene-5-methoxycarbonyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxy-3,5-dihydroxy-6-[2-(4-hydroxyphenyl)ethoxy]oxan-2-yl]methoxy]-2-oxoethyl]-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate
Internal ID | 1ef720e7-d7f8-41d8-94e5-3a47f3804460 |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | methyl (4S,5E,6S)-5-ethylidene-4-[2-[[(2R,3R,4S,5R,6R)-4-[2-[(2S,3E,4S)-3-ethylidene-5-methoxycarbonyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxy-3,5-dihydroxy-6-[2-(4-hydroxyphenyl)ethoxy]oxan-2-yl]methoxy]-2-oxoethyl]-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate |
SMILES (Canonical) | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OCC3C(C(C(C(O3)OCCC4=CC=C(C=C4)O)O)OC(=O)CC5C(=COC(C5=CC)OC6C(C(C(C(O6)CO)O)O)O)C(=O)OC)O |
SMILES (Isomeric) | C/C=C/1\[C@@H](C(=CO[C@H]1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)C(=O)OC)CC(=O)OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)OCCC4=CC=C(C=C4)O)O)OC(=O)C[C@@H]\5C(=CO[C@H](/C5=C/C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C(=O)OC)O |
InChI | InChI=1S/C48H64O27/c1-5-22-24(26(42(62)64-3)17-68-44(22)74-47-38(59)36(57)33(54)28(15-49)70-47)13-31(52)67-19-30-35(56)41(40(61)46(72-30)66-12-11-20-7-9-21(51)10-8-20)73-32(53)14-25-23(6-2)45(69-18-27(25)43(63)65-4)75-48-39(60)37(58)34(55)29(16-50)71-48/h5-10,17-18,24-25,28-30,33-41,44-51,54-61H,11-16,19H2,1-4H3/b22-5+,23-6+/t24-,25-,28+,29+,30+,33+,34+,35+,36-,37-,38+,39+,40+,41-,44-,45-,46+,47-,48-/m0/s1 |
InChI Key | SCKRHUVAHHWUON-XQKJIMGQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H64O27 |
Molecular Weight | 1073.00 g/mol |
Exact Mass | 1072.36349676 g/mol |
Topological Polar Surface Area (TPSA) | 402.00 Ų |
XlogP | -3.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.99% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.67% | 91.11% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 95.27% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.62% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 93.41% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.25% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.99% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.44% | 94.73% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 89.05% | 94.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.32% | 95.64% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.21% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.17% | 91.49% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.40% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.90% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.71% | 94.33% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.93% | 97.79% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.65% | 95.83% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.46% | 94.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.45% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.06% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.23% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligustrum lucidum |
PubChem | 163194433 |
LOTUS | LTS0103668 |
wikiData | Q105250246 |