[(2S,3S,5R,8R,13S,17S)-8-acetyloxy-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate
Internal ID | bad0cadf-edf1-423c-8ca9-e6b9db1a7779 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Aconitane-type diterpenoid alkaloids |
IUPAC Name | [(2S,3S,5R,8R,13S,17S)-8-acetyloxy-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate |
SMILES (Canonical) | CCN1CC2(CCC(C34C2C(C(C31)C5(CC(C6CC4C5C6OC(=O)C7=CC=C(C=C7)OC)OC)OC(=O)C)OC)OC)COC |
SMILES (Isomeric) | CCN1C[C@@]2(CCC(C34[C@H]2C(C(C31)[C@]5(CC([C@H]6C[C@H]4[C@H]5C6OC(=O)C7=CC=C(C=C7)OC)OC)OC(=O)C)OC)OC)COC |
InChI | InChI=1S/C35H49NO9/c1-8-36-17-33(18-39-3)14-13-25(42-6)35-23-15-22-24(41-5)16-34(45-19(2)37,27(31(35)36)29(43-7)30(33)35)26(23)28(22)44-32(38)20-9-11-21(40-4)12-10-20/h9-12,22-31H,8,13-18H2,1-7H3/t22-,23+,24?,25?,26+,27?,28?,29?,30+,31?,33+,34-,35?/m1/s1 |
InChI Key | LYUPEIXJYAJCHL-RRJUMKPBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H49NO9 |
Molecular Weight | 627.80 g/mol |
Exact Mass | 627.34073214 g/mol |
Topological Polar Surface Area (TPSA) | 102.00 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.62% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.62% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.27% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.64% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.27% | 90.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.90% | 97.25% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.31% | 91.19% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.52% | 92.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.15% | 92.94% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.99% | 93.99% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.85% | 95.89% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.32% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.92% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.83% | 98.95% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.81% | 100.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.42% | 85.14% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.18% | 97.28% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.69% | 97.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.16% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.31% | 91.07% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.96% | 94.00% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 80.99% | 94.97% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.77% | 97.21% |
CHEMBL3820 | P35557 | Hexokinase type IV | 80.61% | 91.96% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.52% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aconitum carmichaelii |
Aconitum forrestii |
Aconitum hemsleyanum |
Aconitum transsectum |
PubChem | 138114719 |
LOTUS | LTS0128384 |
wikiData | Q104393779 |