16-Hydroxy-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one
Internal ID | 81960f96-e216-4587-a3df-25fd56171ab7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 16-hydroxy-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
SMILES (Canonical) | CC(CCC=C(C)C)C1C(CC2(C1(CCC3C2=CCC4C3(CCC(=O)C4(C)C)C)C)C)O |
SMILES (Isomeric) | CC(CCC=C(C)C)C1C(CC2(C1(CCC3C2=CCC4C3(CCC(=O)C4(C)C)C)C)C)O |
InChI | InChI=1S/C30H48O2/c1-19(2)10-9-11-20(3)26-23(31)18-30(8)22-12-13-24-27(4,5)25(32)15-16-28(24,6)21(22)14-17-29(26,30)7/h10,12,20-21,23-24,26,31H,9,11,13-18H2,1-8H3 |
InChI Key | YORJEFOAAXJWIS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O2 |
Molecular Weight | 440.70 g/mol |
Exact Mass | 440.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 7.50 |
21688-61-9 |
(9R,10R,13S,14S,16S,17S)-16-hydroxy-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
16-hydroxylanosta-7,24-dien-3-one |
DTXSID20944290 |
NSC126319 |
NSC-126319 |
![2D Structure of 16-Hydroxy-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one 2D Structure of 16-Hydroxy-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/f1496dc0-868b-11ee-9117-0db7c4c2bf28.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.73% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 95.61% | 94.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.49% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.19% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.89% | 98.95% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.23% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.92% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.07% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.55% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.30% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.24% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.51% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.82% | 90.71% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.01% | 93.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.91% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.32% | 92.62% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.27% | 97.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.09% | 95.93% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.44% | 95.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.00% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Azadirachta indica |
Melia azedarach |
Melia dubia |
PubChem | 277443 |
LOTUS | LTS0232597 |
wikiData | Q105351480 |