1,3-Benzodioxol-5-yl-[5-(1,3-benzodioxol-5-yl)-4-[[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxymethyl]oxolan-3-yl]methanone
Internal ID | 5f929f88-570f-4480-b35f-dca525573267 |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | 1,3-benzodioxol-5-yl-[5-(1,3-benzodioxol-5-yl)-4-[[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxymethyl]oxolan-3-yl]methanone |
SMILES (Canonical) | C1C(C(C(O1)C2=CC3=C(C=C2)OCO3)COC4C(C(C(C(O4)CO)O)O)OC5C(C(C(C(O5)CO)O)O)O)C(=O)C6=CC7=C(C=C6)OCO7 |
SMILES (Isomeric) | C1C(C(C(O1)C2=CC3=C(C=C2)OCO3)COC4C(C(C(C(O4)CO)O)O)OC5C(C(C(C(O5)CO)O)O)O)C(=O)C6=CC7=C(C=C6)OCO7 |
InChI | InChI=1S/C32H38O17/c33-7-21-24(36)26(38)28(40)31(47-21)49-30-27(39)25(37)22(8-34)48-32(30)42-10-16-15(23(35)13-1-3-17-19(5-13)45-11-43-17)9-41-29(16)14-2-4-18-20(6-14)46-12-44-18/h1-6,15-16,21-22,24-34,36-40H,7-12H2 |
InChI Key | DLXLJSCTMBEGCD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H38O17 |
Molecular Weight | 694.60 g/mol |
Exact Mass | 694.21089974 g/mol |
Topological Polar Surface Area (TPSA) | 242.00 Ų |
XlogP | -1.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.05% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.27% | 97.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.72% | 94.80% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.60% | 95.93% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.87% | 96.77% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.55% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.90% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.50% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.37% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.97% | 92.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.80% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 84.84% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.79% | 96.61% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.35% | 95.83% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.01% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.55% | 90.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.07% | 100.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.67% | 89.67% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.36% | 85.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sesamum indicum |
PubChem | 163043977 |
LOTUS | LTS0248736 |
wikiData | Q104984846 |