(2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-4-hydroxy-2-(hydroxymethyl)-6-[(1R,2S,3'S,4S,5'S,6S,7S,8R,9S,12S,13S,16S,18R)-5',7,9,13-tetramethyl-3'-[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 581010de-7c81-498f-82b9-c2fd1037bcf5 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-4-hydroxy-2-(hydroxymethyl)-6-[(1R,2S,3'S,4S,5'S,6S,7S,8R,9S,12S,13S,16S,18R)-5',7,9,13-tetramethyl-3'-[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CC(C2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(CO9)O)O)O)C)C)C)OC1)OC1C(C(C(CO1)O)O)O |
SMILES (Isomeric) | C[C@H]1C[C@@H]([C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC[C@H]6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O)O)O)C)C)C)OC1)O[C@@H]1[C@H]([C@@H]([C@H](CO1)O)O)O |
InChI | InChI=1S/C49H80O21/c1-19-12-31(67-43-37(57)34(54)27(51)17-61-43)49(63-16-19)20(2)32-29(70-49)14-26-24-7-6-22-13-23(8-10-47(22,4)25(24)9-11-48(26,32)5)65-46-42(69-44-38(58)35(55)28(52)18-62-44)40(60)41(30(15-50)66-46)68-45-39(59)36(56)33(53)21(3)64-45/h19-46,50-60H,6-18H2,1-5H3/t19-,20-,21-,22+,23-,24+,25-,26-,27-,28+,29-,30+,31-,32-,33-,34+,35-,36+,37-,38+,39+,40-,41+,42+,43+,44-,45-,46+,47-,48-,49-/m0/s1 |
InChI Key | WIQRSGSATANHDI-FIQBMPOHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C49H80O21 |
Molecular Weight | 1005.10 g/mol |
Exact Mass | 1004.51920956 g/mol |
Topological Polar Surface Area (TPSA) | 315.00 Ų |
XlogP | -0.80 |
There are no found synonyms. |
![2D Structure of (2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-4-hydroxy-2-(hydroxymethyl)-6-[(1R,2S,3'S,4S,5'S,6S,7S,8R,9S,12S,13S,16S,18R)-5',7,9,13-tetramethyl-3'-[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of (2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-4-hydroxy-2-(hydroxymethyl)-6-[(1R,2S,3'S,4S,5'S,6S,7S,8R,9S,12S,13S,16S,18R)-5',7,9,13-tetramethyl-3'-[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/f12407d0-8577-11ee-bb39-e5982968113c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.29% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.11% | 91.11% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 96.09% | 92.94% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.78% | 96.61% |
CHEMBL204 | P00734 | Thrombin | 94.79% | 96.01% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.08% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.00% | 97.09% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 92.37% | 95.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.99% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 89.13% | 98.10% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 88.83% | 89.05% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.75% | 89.00% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 87.98% | 95.36% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.89% | 95.93% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.40% | 96.43% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.29% | 95.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.78% | 86.33% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.54% | 95.58% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.36% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.58% | 95.89% |
CHEMBL233 | P35372 | Mu opioid receptor | 85.54% | 97.93% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.52% | 92.86% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.51% | 95.89% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.99% | 97.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.17% | 92.50% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 83.91% | 97.86% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.84% | 91.24% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 83.51% | 97.31% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.43% | 97.36% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.86% | 92.62% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.75% | 92.88% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.26% | 94.75% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.99% | 96.21% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.79% | 96.77% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.51% | 92.32% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 80.95% | 98.99% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 80.72% | 100.00% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 80.67% | 80.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.27% | 94.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.26% | 100.00% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 80.13% | 91.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asparagus filicinus |
PubChem | 101523866 |
LOTUS | LTS0056764 |
wikiData | Q105306447 |