[13-(Furan-2-yl)-3,9-dihydroxy-4,6,6,12-tetramethyl-15-propan-2-yl-8,14,19,20-tetraoxahexacyclo[13.3.1.13,18.02,7.09,18.012,17]icos-4-en-2-yl] acetate
| Internal ID | 547f5c66-ee01-4ecd-99bf-64b358db6ba1 |
| Taxonomy | Organoheterocyclic compounds > Furopyrans |
| IUPAC Name | [13-(furan-2-yl)-3,9-dihydroxy-4,6,6,12-tetramethyl-15-propan-2-yl-8,14,19,20-tetraoxahexacyclo[13.3.1.13,18.02,7.09,18.012,17]icos-4-en-2-yl] acetate |
| SMILES (Canonical) | CC1=CC(C2C3(C1(OC45C3OC6(CC4C(CCC5(O2)O)(C(O6)C7=CC=CO7)C)C(C)C)O)OC(=O)C)(C)C |
| SMILES (Isomeric) | CC1=CC(C2C3(C1(OC45C3OC6(CC4C(CCC5(O2)O)(C(O6)C7=CC=CO7)C)C(C)C)O)OC(=O)C)(C)C |
| InChI | InChI=1S/C29H38O9/c1-15(2)25-14-19-24(7,20(35-25)18-9-8-12-33-18)10-11-26(31)27(19)22(36-25)28(34-17(4)30)21(37-26)23(5,6)13-16(3)29(28,32)38-27/h8-9,12-13,15,19-22,31-32H,10-11,14H2,1-7H3 |
| InChI Key | HNHSTMBFHBATJM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H38O9 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.25158279 g/mol |
| Topological Polar Surface Area (TPSA) | 117.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.52% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.34% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.43% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.17% | 95.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.09% | 93.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.99% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.02% | 97.25% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.40% | 97.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.04% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.87% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.76% | 94.45% |
| CHEMBL5028 | O14672 | ADAM10 | 83.74% | 97.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.98% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.50% | 95.89% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.89% | 82.69% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.50% | 98.95% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.24% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.75% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Entandrophragma utile |
| PubChem | 163022002 |
| LOTUS | LTS0069250 |
| wikiData | Q105030877 |