[(1R,12R,13S,14R,15S)-1-hydroxy-3-methoxy-12-(4-methoxyphenyl)-14-[(2S)-2-(2-methylpropanoylamino)pyrrolidine-1-carbonyl]-13-phenyl-5,7,11-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-trien-15-yl] acetate
Internal ID | 6df17ce1-49e8-4089-b808-0e788f50e2b0 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 5-O-methylated flavonoids |
IUPAC Name | [(1R,12R,13S,14R,15S)-1-hydroxy-3-methoxy-12-(4-methoxyphenyl)-14-[(2S)-2-(2-methylpropanoylamino)pyrrolidine-1-carbonyl]-13-phenyl-5,7,11-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-trien-15-yl] acetate |
SMILES (Canonical) | CC(C)C(=O)NC1CCCN1C(=O)C2C(C3(C(C2(C4=C(C5=C(C=C4O3)OCO5)OC)O)OC(=O)C)C6=CC=C(C=C6)OC)C7=CC=CC=C7 |
SMILES (Isomeric) | CC(C)C(=O)N[C@@H]1CCCN1C(=O)[C@@H]2[C@H]([C@]3([C@H]([C@@]2(C4=C(C5=C(C=C4O3)OCO5)OC)O)OC(=O)C)C6=CC=C(C=C6)OC)C7=CC=CC=C7 |
InChI | InChI=1S/C37H40N2O10/c1-20(2)33(41)38-27-12-9-17-39(27)34(42)30-28(22-10-7-6-8-11-22)37(23-13-15-24(44-4)16-14-23)35(48-21(3)40)36(30,43)29-25(49-37)18-26-31(32(29)45-5)47-19-46-26/h6-8,10-11,13-16,18,20,27-28,30,35,43H,9,12,17,19H2,1-5H3,(H,38,41)/t27-,28+,30-,35-,36-,37-/m0/s1 |
InChI Key | UHVMWNGRKKYVIY-VCGIKDRKSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C37H40N2O10 |
Molecular Weight | 672.70 g/mol |
Exact Mass | 672.26829548 g/mol |
Topological Polar Surface Area (TPSA) | 142.00 Ų |
XlogP | 4.20 |
There are no found synonyms. |
![2D Structure of [(1R,12R,13S,14R,15S)-1-hydroxy-3-methoxy-12-(4-methoxyphenyl)-14-[(2S)-2-(2-methylpropanoylamino)pyrrolidine-1-carbonyl]-13-phenyl-5,7,11-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-trien-15-yl] acetate 2D Structure of [(1R,12R,13S,14R,15S)-1-hydroxy-3-methoxy-12-(4-methoxyphenyl)-14-[(2S)-2-(2-methylpropanoylamino)pyrrolidine-1-carbonyl]-13-phenyl-5,7,11-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-trien-15-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/f0cfa820-8679-11ee-b3fe-37763958b256.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.94% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.69% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 98.12% | 98.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.64% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.62% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.36% | 95.56% |
CHEMBL204 | P00734 | Thrombin | 95.22% | 96.01% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 93.71% | 99.18% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.12% | 92.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.08% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.01% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.70% | 90.00% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 90.63% | 89.44% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.33% | 91.19% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.94% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.40% | 93.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.98% | 96.00% |
CHEMBL5028 | O14672 | ADAM10 | 87.46% | 97.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.46% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.11% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.97% | 99.23% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.30% | 93.99% |
CHEMBL2535 | P11166 | Glucose transporter | 84.23% | 98.75% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.47% | 94.08% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 83.47% | 98.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.12% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.97% | 89.00% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.90% | 96.25% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.42% | 93.00% |
CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 81.61% | 82.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.54% | 90.17% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.41% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aglaia edulis |
PubChem | 10604507 |
LOTUS | LTS0009538 |
wikiData | Q105273117 |