(1S,2S,4R,6S,9R,10R,11R,14R,15R)-9-hydroxy-2,9,11,14,19,19-hexamethyl-6-prop-1-en-2-yl-17-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[12.8.0.02,11.04,10.015,20]docosa-16,20-diene-8,13,18-trione
| Internal ID | ce19527e-fa81-4ff8-8a3f-96cbdfd4b725 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | (1S,2S,4R,6S,9R,10R,11R,14R,15R)-9-hydroxy-2,9,11,14,19,19-hexamethyl-6-prop-1-en-2-yl-17-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[12.8.0.02,11.04,10.015,20]docosa-16,20-diene-8,13,18-trione |
| SMILES (Canonical) | CC(=C)C1CC(=O)C(C2C(O1)CC3(C2(CC(=O)C4(C3CC=C5C4C=C(C(=O)C5(C)C)OC6C(C(C(C(O6)CO)O)O)O)C)C)C)(C)O |
| SMILES (Isomeric) | CC(=C)[C@@H]1CC(=O)[C@]([C@H]2[C@H](O1)C[C@@]3([C@@]2(CC(=O)[C@@]4([C@H]3CC=C5[C@H]4C=C(C(=O)C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)C)C)(C)O |
| InChI | InChI=1S/C36H50O11/c1-16(2)19-12-24(38)36(8,44)29-21(45-19)13-33(5)23-10-9-17-18(35(23,7)25(39)14-34(29,33)6)11-20(30(43)32(17,3)4)46-31-28(42)27(41)26(40)22(15-37)47-31/h9,11,18-19,21-23,26-29,31,37,40-42,44H,1,10,12-15H2,2-8H3/t18-,19+,21-,22-,23+,26-,27+,28-,29+,31-,33+,34-,35+,36+/m1/s1 |
| InChI Key | WXOQVIJCYNJZTP-RSZQLLDLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C36H50O11 |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.33531241 g/mol |
| Topological Polar Surface Area (TPSA) | 180.00 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.01% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.15% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.95% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.69% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.02% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.26% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.78% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.26% | 100.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.50% | 96.77% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.98% | 94.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.49% | 89.34% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.51% | 94.73% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.99% | 95.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.86% | 96.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.35% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrullus colocynthis |
| PubChem | 101508371 |
| LOTUS | LTS0102199 |
| wikiData | Q105314797 |