(2S)-2-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one
Internal ID | 4d586c6b-e99b-44bc-8fc4-968a926cabf2 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | (2S)-2-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | C1C(OC2=C(C1=O)C=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O)C4=CC(=C(C=C4)O)OC5C(C(C(C(O5)CO)O)O)O |
SMILES (Isomeric) | C1[C@H](OC2=C(C1=O)C=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O)C4=CC(=C(C=C4)O)OC5C(C(C(C(O5)CO)O)O)O |
InChI | InChI=1S/C27H32O15/c28-8-18-20(32)22(34)24(36)26(41-18)38-11-2-3-12-14(31)7-15(39-16(12)6-11)10-1-4-13(30)17(5-10)40-27-25(37)23(35)21(33)19(9-29)42-27/h1-6,15,18-30,32-37H,7-9H2/t15-,18?,19?,20?,21?,22?,23?,24?,25?,26?,27?/m0/s1 |
InChI Key | QVCQYYYTMIZOGK-HBPRQHIFSA-N |
Popularity | 6 references in papers |
Molecular Formula | C27H32O15 |
Molecular Weight | 596.50 g/mol |
Exact Mass | 596.17412031 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -1.80 |
LMPK12140065 |
![2D Structure of (2S)-2-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one 2D Structure of (2S)-2-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/07/f09f78e0-236f-11ee-ba36-7903e799af64.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.62% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.87% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.90% | 96.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.80% | 96.21% |
CHEMBL2581 | P07339 | Cathepsin D | 94.14% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.26% | 99.15% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.25% | 93.40% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.13% | 90.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.49% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.19% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.17% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.16% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.59% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.56% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.21% | 91.49% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.51% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.47% | 86.33% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.89% | 95.78% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.02% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Robinia pseudoacacia |