Excoecariatoxin
Internal ID | b717ca2a-ad88-4ab8-a3d1-24d65e64250e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Rhamnofolane and daphnane diterpenoids |
IUPAC Name | (1R,2R,6S,7S,8R,10S,11S,12R,16R,18R)-6,7-dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-14-[(1E,3E)-nona-1,3-dienyl]-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-5-one |
SMILES (Canonical) | CCCCCC=CC=CC12OC3C4C5C(O5)(C(C6(C(C4(O1)C(CC3(O2)C(=C)C)C)C=C(C6=O)C)O)O)CO |
SMILES (Isomeric) | CCCCC/C=C/C=C/C12O[C@@H]3[C@@H]4[C@H]5[C@](O5)([C@H]([C@]6([C@H]([C@@]4(O1)[C@@H](C[C@@]3(O2)C(=C)C)C)C=C(C6=O)C)O)O)CO |
InChI | InChI=1S/C30H40O8/c1-6-7-8-9-10-11-12-13-28-36-23-21-24-27(16-31,35-24)25(33)29(34)20(14-18(4)22(29)32)30(21,38-28)19(5)15-26(23,37-28)17(2)3/h10-14,19-21,23-25,31,33-34H,2,6-9,15-16H2,1,3-5H3/b11-10+,13-12+/t19-,20-,21-,23-,24+,25-,26-,27+,28?,29-,30+/m1/s1 |
InChI Key | CZCPFHFUOUQBDL-NBYZGKQKSA-N |
Popularity | 3 references in papers |
Molecular Formula | C30H40O8 |
Molecular Weight | 528.60 g/mol |
Exact Mass | 528.27231823 g/mol |
Topological Polar Surface Area (TPSA) | 118.00 Ų |
XlogP | 3.60 |
Terpenoid EA-I |
92219-48-2 |
22,23,24,25-Tetradehydro-simplexin |
C09198 |
CHEBI:9456 |
Q27108400 |
dihydroxy-(hydroxymethyl)-isopropenyl-dimethyl-[(1E,3E)-nona-1,3-dienyl][?]one |
(1R,2R,6S,7S,8R,10S,11S,12R,16R,18R)-6,7-dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-14-[(1E,3E)-nona-1,3-dienyl]-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-5-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.20% | 91.11% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 95.22% | 97.79% |
CHEMBL2581 | P07339 | Cathepsin D | 93.58% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.82% | 96.09% |
CHEMBL299 | P17252 | Protein kinase C alpha | 92.48% | 98.03% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 91.98% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.97% | 99.17% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 90.82% | 96.90% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.78% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.51% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.96% | 94.73% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.81% | 96.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.30% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.72% | 89.00% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 86.17% | 92.32% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.90% | 94.80% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.65% | 90.08% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.39% | 97.25% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 82.30% | 85.94% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.95% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.29% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.25% | 97.09% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.10% | 89.34% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.23% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Diarthron vesiculosum |
Excoecaria cochinchinensis |
Lasiosiphon kraussianus |
Wikstroemia monticola |
PubChem | 5281400 |
LOTUS | LTS0088665 |
wikiData | Q27108400 |