Eupomatenoid 5
| Internal ID | 8a6ee481-c12b-418c-835d-1f2445ab7130 |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 2-methoxy-4-[3-methyl-5-[(E)-prop-1-enyl]-1-benzofuran-2-yl]phenol |
| SMILES (Canonical) | CC=CC1=CC2=C(C=C1)OC(=C2C)C3=CC(=C(C=C3)O)OC |
| SMILES (Isomeric) | C/C=C/C1=CC2=C(C=C1)OC(=C2C)C3=CC(=C(C=C3)O)OC |
| InChI | InChI=1S/C19H18O3/c1-4-5-13-6-9-17-15(10-13)12(2)19(22-17)14-7-8-16(20)18(11-14)21-3/h4-11,20H,1-3H3/b5-4+ |
| InChI Key | HMGCTPMQYVGXSC-SNAWJCMRSA-N |
| Popularity | 18 references in papers |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.125594432 g/mol |
| Topological Polar Surface Area (TPSA) | 42.60 Ų |
| XlogP | 5.00 |
| 41744-28-9 |
| 2-methoxy-4-[3-methyl-5-[(E)-prop-1-enyl]-1-benzofuran-2-yl]phenol |
| Eupomatenoid-5 |
| 2-Methoxy-4-[3-methyl-5-[(E)-1-propenyl]benzofuran-2-yl]phenol |
| CHEMBL4565833 |
| DTXSID701317176 |
| 2-(4'-Hydroxy-3'-methoxyphenyl)-3-methyl-5(E)-propenylbenzofuran |
| AKOS040734921 |
| NCGC00385078-01 |
| 2-methoxy-4-[3-methyl-5-[(E)-prop-1-enyl]benzofuran-2-yl]phenol |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.53% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.61% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.69% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.07% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.49% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 91.52% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.13% | 96.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.24% | 99.15% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.92% | 93.31% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.40% | 94.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 86.62% | 98.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.29% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.01% | 95.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.81% | 92.94% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.92% | 94.73% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.88% | 93.65% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.12% | 91.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.15% | 94.45% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 81.10% | 98.35% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.97% | 89.62% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.09% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Caryodaphnopsis baviensis |
| Caryodaphnopsis tonkinensis |
| Eupomatia bennettii |
| Eupomatia laurina |
| Magnolia yunnanensis |
| Piper aequale |
| Piper decurrens |
| Piper regnellii |
| Piper solmsianum |
| PubChem | 6443783 |
| LOTUS | LTS0196816 |
| wikiData | Q104399758 |