Ethyl 1-methylpiperidine-3-carboxylate
| Internal ID | 0e4ff4ec-ec45-4302-b174-3805765fb79c |
| Taxonomy | Organoheterocyclic compounds > Piperidines > Piperidinecarboxylic acids and derivatives > Piperidinecarboxylic acids |
| IUPAC Name | ethyl 1-methylpiperidine-3-carboxylate |
| SMILES (Canonical) | CCOC(=O)C1CCCN(C1)C |
| SMILES (Isomeric) | CCOC(=O)C1CCCN(C1)C |
| InChI | InChI=1S/C9H17NO2/c1-3-12-9(11)8-5-4-6-10(2)7-8/h8H,3-7H2,1-2H3 |
| InChI Key | VFJJNMLPRDRTCO-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.125928785 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 1.00 |
| Ethyl 1-methylpiperidine-3-carboxylate |
| Ethyl 1-methyl-3-piperidinecarboxylate |
| EINECS 225-951-0 |
| VFJJNMLPRDRTCO-UHFFFAOYSA- |
| DTXSID701282086 |
| NSC 64739 |
| RefChem:593355 |
| DTXCID30893407 |
| 225-951-0 |
| InChI=1/C9H17NO2/c1-3-12-9(11)8-5-4-6-10(2)7-8/h8H,3-7H2,1-2H3 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.49% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.24% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.00% | 98.95% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 89.85% | 98.77% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 88.91% | 97.47% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.56% | 97.09% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.74% | 93.03% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.68% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.61% | 93.56% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.51% | 95.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.41% | 94.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.19% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.13% | 92.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.50% | 95.56% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.21% | 97.50% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.59% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Areca catechu |
| PubChem | 97981 |
| NPASS | NPC135197 |
| LOTUS | LTS0082807 |
| wikiData | Q105285327 |