erythro-Guaiacylglycerol beta-dihydroconiferyl ether
Internal ID | bbeaedbb-5cdc-44b4-8759-338fa1993822 |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)-2-[4-(3-hydroxypropyl)-2-methoxyphenoxy]propane-1,3-diol |
SMILES (Canonical) | COC1=C(C=CC(=C1)CCCO)OC(CO)C(C2=CC(=C(C=C2)O)OC)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)CCCO)OC(CO)C(C2=CC(=C(C=C2)O)OC)O |
InChI | InChI=1S/C20H26O7/c1-25-17-11-14(6-7-15(17)23)20(24)19(12-22)27-16-8-5-13(4-3-9-21)10-18(16)26-2/h5-8,10-11,19-24H,3-4,9,12H2,1-2H3 |
InChI Key | DBIKJXXBCAHHMC-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C20H26O7 |
Molecular Weight | 378.40 g/mol |
Exact Mass | 378.16785316 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 1.60 |
SCHEMBL671427 |
1-(4-hydroxy-3-methoxyphenyl)-2-[4-(3-hydroxypropyl)-2-methoxyphenoxy]-propane-1,3-diol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.11% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 98.08% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.99% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.17% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 93.06% | 90.20% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.81% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.05% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.34% | 86.92% |
CHEMBL2535 | P11166 | Glucose transporter | 89.18% | 98.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.05% | 91.11% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.01% | 89.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.53% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.10% | 99.15% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 83.42% | 87.16% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.70% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.11% | 90.00% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 82.00% | 97.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.99% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.75% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona squamosa |
Croton lechleri |
Epimedium sagittatum |
Euterpe oleracea |
Helianthus annuus |
Magnolia officinalis |
Pinus sylvestris |
Santalum album |
PubChem | 5318277 |
LOTUS | LTS0212414 |
wikiData | Q104974415 |