Erythrartine
Internal ID | 5b173a7a-0e47-454d-8b22-e2c678ff600e |
Taxonomy | Alkaloids and derivatives > Erythrina alkaloids > Erythrinanes |
IUPAC Name | (2R,9R,13bS)-2,11,12-trimethoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinolin-9-ol |
SMILES (Canonical) | COC1CC23C(=CCN2CC(C4=CC(=C(C=C34)OC)OC)O)C=C1 |
SMILES (Isomeric) | CO[C@@H]1C[C@@]23C(=CCN2C[C@@H](C4=CC(=C(C=C34)OC)OC)O)C=C1 |
InChI | InChI=1S/C19H23NO4/c1-22-13-5-4-12-6-7-20-11-16(21)14-8-17(23-2)18(24-3)9-15(14)19(12,20)10-13/h4-6,8-9,13,16,21H,7,10-11H2,1-3H3/t13-,16-,19-/m0/s1 |
InChI Key | QWWCVLZNFFVFTR-AXHNFQJDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H23NO4 |
Molecular Weight | 329.40 g/mol |
Exact Mass | 329.16270821 g/mol |
Topological Polar Surface Area (TPSA) | 51.20 Ų |
XlogP | 1.00 |
51666-26-3 |
(2R,9R,13bS)-2,11,12-trimethoxy-2,6,8,9-tetrahydro-1H-indolo[7a,1-a]isoquinolin-9-ol |
(+)-Erythrartine; 11-Hydroxyerysotrine |
AKOS032962322 |
FS-9954 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.47% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.71% | 92.94% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.92% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.14% | 85.14% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.81% | 89.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.63% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.21% | 86.33% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.47% | 91.03% |
CHEMBL2581 | P07339 | Cathepsin D | 83.92% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.72% | 97.14% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.14% | 91.07% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.74% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.55% | 97.25% |
CHEMBL2535 | P11166 | Glucose transporter | 80.02% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erythrina bidwillii |
Erythrina lysistemon |
Erythrina poeppigiana |
Erythrina verna |
PubChem | 11336443 |
LOTUS | LTS0057939 |
wikiData | Q104399110 |