Ergotamine
Internal ID | eb74a0f2-c5e9-4ab9-9376-6aea75cd3e8e |
Taxonomy | Alkaloids and derivatives > Ergoline and derivatives > Lysergic acids and derivatives > Ergopeptines > Ergotamines, dihydroergotamines, and derivatives |
IUPAC Name | (6aR,9R)-N-[(1S,2S,4R,7S)-7-benzyl-2-hydroxy-4-methyl-5,8-dioxo-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodecan-4-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
SMILES (Canonical) | CC1(C(=O)N2C(C(=O)N3CCCC3C2(O1)O)CC4=CC=CC=C4)NC(=O)C5CN(C6CC7=CNC8=CC=CC(=C78)C6=C5)C |
SMILES (Isomeric) | C[C@@]1(C(=O)N2[C@H](C(=O)N3CCC[C@H]3[C@@]2(O1)O)CC4=CC=CC=C4)NC(=O)[C@H]5CN([C@@H]6CC7=CNC8=CC=CC(=C78)C6=C5)C |
InChI | InChI=1S/C33H35N5O5/c1-32(35-29(39)21-15-23-22-10-6-11-24-28(22)20(17-34-24)16-25(23)36(2)18-21)31(41)38-26(14-19-8-4-3-5-9-19)30(40)37-13-7-12-27(37)33(38,42)43-32/h3-6,8-11,15,17,21,25-27,34,42H,7,12-14,16,18H2,1-2H3,(H,35,39)/t21-,25-,26+,27+,32-,33+/m1/s1 |
InChI Key | XCGSFFUVFURLIX-VFGNJEKYSA-N |
Popularity | 7,066 references in papers |
Molecular Formula | C33H35N5O5 |
Molecular Weight | 581.70 g/mol |
Exact Mass | 581.26381923 g/mol |
Topological Polar Surface Area (TPSA) | 118.00 Ų |
XlogP | 2.00 |
Atomic LogP (AlogP) | 1.99 |
H-Bond Acceptor | 6 |
H-Bond Donor | 3 |
Rotatable Bonds | 4 |
Ergotamin |
Gynergen |
Ergonsvine |
Ergostat |
ergotamine tartrate |
ergotaminum |
Ergotamina |
Ergomar |
113-15-5 |
Ergotaminum [INN-Latin] |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9621 | 96.21% |
Caco-2 | - | 0.8399 | 83.99% |
Blood Brain Barrier | - | 0.9000 | 90.00% |
Human oral bioavailability | - | 0.9429 | 94.29% |
Subcellular localzation | Nucleus | 0.3523 | 35.23% |
OATP2B1 inhibitior | - | 0.5751 | 57.51% |
OATP1B1 inhibitior | + | 0.7308 | 73.08% |
OATP1B3 inhibitior | + | 0.9078 | 90.78% |
MATE1 inhibitior | + | 0.9967 | 99.67% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | + | 0.9776 | 97.76% |
P-glycoprotein inhibitior | + | 0.9511 | 95.11% |
P-glycoprotein substrate | + | 0.7695 | 76.95% |
CYP3A4 substrate | + | 0.7981 | 79.81% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7671 | 76.71% |
CYP3A4 inhibition | + | 0.7959 | 79.59% |
CYP2C9 inhibition | - | 0.9071 | 90.71% |
CYP2C19 inhibition | - | 0.8849 | 88.49% |
CYP2D6 inhibition | - | 0.9230 | 92.30% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | + | 0.6865 | 68.65% |
CYP inhibitory promiscuity | - | 0.6759 | 67.59% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.5016 | 50.16% |
Eye corrosion | - | 0.9888 | 98.88% |
Eye irritation | - | 0.9565 | 95.65% |
Skin irritation | - | 0.7375 | 73.75% |
Skin corrosion | - | 0.9290 | 92.90% |
Ames mutagenesis | - | 0.9400 | 94.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7968 | 79.68% |
Micronuclear | + | 0.9300 | 93.00% |
Hepatotoxicity | - | 0.9608 | 96.08% |
skin sensitisation | - | 0.8683 | 86.83% |
Respiratory toxicity | + | 1.0000 | 100.00% |
Reproductive toxicity | + | 0.9667 | 96.67% |
Mitochondrial toxicity | + | 1.0000 | 100.00% |
Nephrotoxicity | - | 0.8449 | 84.49% |
Acute Oral Toxicity (c) | III | 0.5646 | 56.46% |
Estrogen receptor binding | + | 0.8268 | 82.68% |
Androgen receptor binding | + | 0.8696 | 86.96% |
Thyroid receptor binding | + | 0.5274 | 52.74% |
Glucocorticoid receptor binding | + | 0.7991 | 79.91% |
Aromatase binding | + | 0.6482 | 64.82% |
PPAR gamma | + | 0.8708 | 87.08% |
Honey bee toxicity | - | 0.7843 | 78.43% |
Biodegradation | - | 0.9250 | 92.50% |
Crustacea aquatic toxicity | + | 0.5600 | 56.00% |
Fish aquatic toxicity | + | 0.9833 | 98.33% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
501.2 nM |
Potency |
via Super-PRED
|
CHEMBL1898 | P28222 | Serotonin 1b (5-HT1b) receptor |
2.1 nM |
Ki |
via Super-PRED
|
CHEMBL1983 | P28221 | Serotonin 1d (5-HT1d) receptor |
2.2 nM |
Ki |
via Super-PRED
|
CHEMBL3426 | P47898 | Serotonin 5a (5-HT5a) receptor |
15.49 nM |
Ki |
via Super-PRED
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
446.7 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.89% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.35% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.23% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.15% | 95.56% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 96.01% | 97.64% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.94% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.44% | 95.89% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 93.74% | 95.62% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 93.32% | 93.03% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.63% | 91.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.39% | 82.69% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.75% | 90.17% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 89.52% | 96.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.42% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.57% | 99.23% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 86.72% | 97.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.16% | 86.33% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 84.90% | 92.67% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.85% | 97.09% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 84.68% | 95.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.61% | 94.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.50% | 96.21% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.31% | 92.97% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 83.66% | 97.05% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 83.07% | 98.33% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 82.43% | 85.83% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.71% | 85.11% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 80.96% | 91.43% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.00% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cenchrus echinatus |
Festuca arundinacea |
Festuca pratensis |
PubChem | 8223 |
LOTUS | LTS0042813 |
wikiData | Q419186 |