Eldeline
Internal ID | e9defdbc-57a2-446f-bccf-1f9388aa9989 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Aconitane-type diterpenoid alkaloids |
IUPAC Name | [(1R,2S,3S,4S,5R,6S,8R,12S,13S,16R,19S,20R,21S)-14-ethyl-2-hydroxy-4,6,19-trimethoxy-16-methyl-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosan-21-yl] acetate |
SMILES (Canonical) | CCN1CC2(CCC(C34C2C(C5(C31)C6(CC(C7CC4(C6C7OC)O)OC)OCO5)OC(=O)C)OC)C |
SMILES (Isomeric) | CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]2[C@@H]([C@@]5([C@H]31)[C@]6(C[C@@H]([C@H]7C[C@@]4([C@@H]6[C@H]7OC)O)OC)OCO5)OC(=O)C)OC)C |
InChI | InChI=1S/C27H41NO8/c1-7-28-12-23(3)9-8-17(32-5)26-20(23)21(36-14(2)29)27(22(26)28)25(34-13-35-27)11-16(31-4)15-10-24(26,30)19(25)18(15)33-6/h15-22,30H,7-13H2,1-6H3/t15-,16+,17+,18+,19+,20-,21+,22+,23+,24+,25-,26-,27-/m1/s1 |
InChI Key | DTTPWCNKTMQMTE-TYNNPWLESA-N |
Popularity | 14 references in papers |
Molecular Formula | C27H41NO8 |
Molecular Weight | 507.60 g/mol |
Exact Mass | 507.28321727 g/mol |
Topological Polar Surface Area (TPSA) | 95.90 Ų |
XlogP | 0.60 |
Eldelin |
Eldeline |
6836-11-9 |
Deltamine 6-acetate |
DTXSID40896808 |
AKOS037514617 |
6beta,10-dihydroxy-1alpha,14alpha,16beta-trimethoxy-4-methyl-7beta,8-(methylenedioxy)- 20-ethylaconitan-6-yl acetate |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.14% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.26% | 97.25% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.11% | 95.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.89% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.97% | 85.14% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.40% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.50% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.28% | 97.09% |
CHEMBL204 | P00734 | Thrombin | 89.78% | 96.01% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.46% | 92.62% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 89.14% | 97.28% |
CHEMBL2581 | P07339 | Cathepsin D | 87.17% | 98.95% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.09% | 97.14% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.84% | 89.05% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.65% | 94.33% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.39% | 86.33% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 82.79% | 95.36% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.68% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.57% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.34% | 92.50% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.68% | 96.77% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.52% | 91.19% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.21% | 82.50% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.20% | 89.50% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.09% | 94.42% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.96% | 93.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.51% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Delphinium anthriscifolium |
Delphinium barbeyi |
Delphinium delavayi |
Delphinium elatum |
Delphinium iliense |
Delphinium majus |
Delphinium occidentale |
PubChem | 92854547 |
LOTUS | LTS0081116 |
wikiData | Q104989029 |