5-Hydroxy-2-(4-hydroxyphenyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-(3,4,5-trihydroxyoxan-2-yl)oxychromen-4-one
Internal ID | 9cff15de-1958-4f7f-927e-ec53e1bd4f74 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-(3,4,5-trihydroxyoxan-2-yl)oxychromen-4-one |
SMILES (Canonical) | C1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC4C(C(C(C(O4)CO)O)O)O)C5=CC=C(C=C5)O)O)O)O)O |
SMILES (Isomeric) | C1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC4C(C(C(C(O4)CO)O)O)O)C5=CC=C(C=C5)O)O)O)O)O |
InChI | InChI=1S/C26H28O15/c27-7-15-18(32)20(34)22(36)26(40-15)41-24-19(33)16-12(29)5-11(38-25-21(35)17(31)13(30)8-37-25)6-14(16)39-23(24)9-1-3-10(28)4-2-9/h1-6,13,15,17-18,20-22,25-32,34-36H,7-8H2 |
InChI Key | JBXDRWCPGRKZIO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28O15 |
Molecular Weight | 580.50 g/mol |
Exact Mass | 580.14282018 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -1.00 |
There are no found synonyms. |
![2D Structure of 5-Hydroxy-2-(4-hydroxyphenyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-(3,4,5-trihydroxyoxan-2-yl)oxychromen-4-one 2D Structure of 5-Hydroxy-2-(4-hydroxyphenyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-(3,4,5-trihydroxyoxan-2-yl)oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/eebc7a70-847b-11ee-ba0a-9fa69d2562af.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.83% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.45% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.33% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.73% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.88% | 91.49% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 93.70% | 95.64% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.24% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.12% | 94.45% |
CHEMBL220 | P22303 | Acetylcholinesterase | 89.78% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.88% | 86.92% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.86% | 95.78% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.33% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.20% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.87% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.61% | 86.33% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.77% | 95.83% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.72% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.07% | 99.17% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 83.98% | 98.35% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 82.83% | 80.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.78% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.31% | 90.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.14% | 96.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.39% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aconitum variegatum |
PubChem | 74978011 |
LOTUS | LTS0106225 |
wikiData | Q105124629 |