(1R,5E,7E,9R,10R,11R,12R,13Z,18R,19S,20R,24S,28R,29S,30S)-10-ethenyl-24,29-dihydroxy-22-(hydroxymethyl)-18,26,30-trimethyl-11-[(1E,3E,5E)-nona-1,3,5-trienyl]-2,16-dioxahexacyclo[16.13.0.01,19.09,12.020,29.024,28]hentriaconta-5,7,13,21,26-pentaene-3,15,25-trione
Internal ID | 8e07a307-adef-44ca-842a-44532eb803f5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (1R,5E,7E,9R,10R,11R,12R,13Z,18R,19S,20R,24S,28R,29S,30S)-10-ethenyl-24,29-dihydroxy-22-(hydroxymethyl)-18,26,30-trimethyl-11-[(1E,3E,5E)-nona-1,3,5-trienyl]-2,16-dioxahexacyclo[16.13.0.01,19.09,12.020,29.024,28]hentriaconta-5,7,13,21,26-pentaene-3,15,25-trione |
SMILES (Canonical) | CCCC=CC=CC=CC1C2C=CC(=O)OCC3(C4C3(CC(C5(C4C=C(CC6(C5C=C(C6=O)C)O)CO)O)C)OC(=O)CC=CC=CC2C1C=C)C |
SMILES (Isomeric) | CCC/C=C/C=C/C=C/[C@H]1[C@@H]2/C=C\C(=O)OC[C@]3([C@H]4[C@@]3(C[C@@H]([C@@]5([C@@H]4C=C(C[C@@]6([C@@H]5C=C(C6=O)C)O)CO)O)C)OC(=O)C/C=C/C=C/[C@@H]2[C@H]1C=C)C |
InChI | InChI=1S/C44H54O8/c1-6-8-9-10-11-12-14-17-32-31(7-2)33-18-15-13-16-19-38(47)52-43-24-29(4)44(50)35(39(43)41(43,5)27-51-37(46)21-20-34(32)33)23-30(26-45)25-42(49)36(44)22-28(3)40(42)48/h7,9-18,20-23,29,31-36,39,45,49-50H,2,6,8,19,24-27H2,1,3-5H3/b10-9+,12-11+,16-13+,17-14+,18-15+,21-20-/t29-,31-,32+,33+,34-,35+,36-,39-,41-,42-,43+,44-/m0/s1 |
InChI Key | GVPDXTWEMCWUNU-SFLWECIPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H54O8 |
Molecular Weight | 710.90 g/mol |
Exact Mass | 710.38186868 g/mol |
Topological Polar Surface Area (TPSA) | 130.00 Ų |
XlogP | 6.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 95.89% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.83% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.57% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.04% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.41% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.41% | 100.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.98% | 96.61% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.48% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.27% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.20% | 96.77% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.05% | 86.33% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.70% | 86.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.10% | 99.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.52% | 97.14% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.29% | 94.75% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 81.06% | 98.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jatropha curcas |
PubChem | 162927369 |
LOTUS | LTS0104131 |
wikiData | Q105021511 |