[(2R,3R,4S,5R,6R)-5-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-6-[(1S,2S,4S,5'S,6R,7S,8R,9S,12S,13R,14R,16R)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]methyl acetate
Internal ID | c4bc112c-e9e2-42ea-951e-c7b180af14a6 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | [(2R,3R,4S,5R,6R)-5-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-6-[(1S,2S,4S,5'S,6R,7S,8R,9S,12S,13R,14R,16R)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]methyl acetate |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(C(CC(C6)O)OC7C(C(C(C(O7)COC(=O)C)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)C)O)OC2C(C(C(C(O2)CO)O)O)O)O)C)C)C)OC1 |
SMILES (Isomeric) | C[C@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5([C@@H](C[C@@H](C6)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)COC(=O)C)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)C)C)C)OC1 |
InChI | InChI=1S/C52H82O23/c1-20-9-12-52(67-17-20)21(2)34-30(75-52)15-28-26-8-7-24-13-25(55)14-33(51(24,6)27(26)10-11-50(28,34)5)71-49-45(44(38(60)32(70-49)19-65-23(4)54)73-46-40(62)36(58)29(56)18-66-46)74-48-42(64)43(35(57)22(3)68-48)72-47-41(63)39(61)37(59)31(16-53)69-47/h7,20-22,25-49,53,55-64H,8-19H2,1-6H3/t20-,21-,22-,25+,26+,27-,28-,29+,30-,31+,32+,33+,34-,35-,36-,37+,38+,39-,40+,41+,42+,43+,44-,45+,46-,47-,48-,49-,50-,51-,52+/m0/s1 |
InChI Key | PFFAJRATKINNEU-JHIOCIPUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C52H82O23 |
Molecular Weight | 1075.20 g/mol |
Exact Mass | 1074.52468886 g/mol |
Topological Polar Surface Area (TPSA) | 341.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.06% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.34% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.11% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.19% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.02% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.18% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.75% | 92.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.27% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.14% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.52% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.26% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.78% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 89.35% | 93.04% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 87.79% | 95.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.89% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.66% | 98.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.48% | 93.56% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.43% | 95.50% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.02% | 91.24% |
CHEMBL5028 | O14672 | ADAM10 | 81.86% | 97.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.75% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.12% | 94.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.07% | 97.28% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.98% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brodiaea californica |
PubChem | 10418661 |
LOTUS | LTS0131924 |
wikiData | Q105207703 |