Echihumiline
Internal ID | 54180f70-3c8a-49a9-9f1e-ea5dcc66353e |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | [(7R,8R)-7-(3-methylbut-2-enoyloxy)-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2R)-2,3-dihydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate |
SMILES (Canonical) | CC(C(C(=O)OCC1=CCN2C1C(CC2)OC(=O)C=C(C)C)(C(C)(C)O)O)O |
SMILES (Isomeric) | C[C@@H]([C@](C(=O)OCC1=CCN2[C@H]1[C@@H](CC2)OC(=O)C=C(C)C)(C(C)(C)O)O)O |
InChI | InChI=1S/C20H31NO7/c1-12(2)10-16(23)28-15-7-9-21-8-6-14(17(15)21)11-27-18(24)20(26,13(3)22)19(4,5)25/h6,10,13,15,17,22,25-26H,7-9,11H2,1-5H3/t13-,15+,17+,20-/m0/s1 |
InChI Key | XQRINBJLKOBTMI-XEQBAVFLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H31NO7 |
Molecular Weight | 397.50 g/mol |
Exact Mass | 397.21005233 g/mol |
Topological Polar Surface Area (TPSA) | 117.00 Ų |
XlogP | 0.20 |
XQRINBJLKOBTMI-XEQBAVFLSA-N |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.99% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.31% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.92% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.22% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.32% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.62% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.83% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.85% | 91.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.89% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.59% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.55% | 95.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.26% | 97.14% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.17% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.81% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 81.33% | 97.50% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 81.29% | 94.97% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.55% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Echium humile |
PubChem | 15286355 |
LOTUS | LTS0177420 |
wikiData | Q105339993 |