Methyl 4a,7-dihydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate
Internal ID | cf10a463-bd19-423f-8f4d-f7ef13428b1b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl 4a,7-dihydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1(CCC2(C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O)O)O |
SMILES (Isomeric) | CC1(CCC2(C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O)O)O |
InChI | InChI=1S/C17H26O11/c1-16(23)3-4-17(24)7(13(22)25-2)6-26-15(12(16)17)28-14-11(21)10(20)9(19)8(5-18)27-14/h6,8-12,14-15,18-21,23-24H,3-5H2,1-2H3 |
InChI Key | RWMXKBUPLSNIJL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H26O11 |
Molecular Weight | 406.40 g/mol |
Exact Mass | 406.14751164 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | -2.20 |
There are no found synonyms. |
![2D Structure of Methyl 4a,7-dihydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate 2D Structure of Methyl 4a,7-dihydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/ece43ec0-85ef-11ee-a970-9dab665679d0.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.98% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.52% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.12% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.94% | 97.25% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.86% | 91.24% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.48% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.30% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 83.16% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.10% | 96.61% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.39% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.70% | 94.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.62% | 96.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.56% | 90.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.37% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.11% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lamium eriocephalum |
Penstemon centranthifolius |
Phlomis armeniaca |
Phlomis aurea |
Phlomis brunneogaleata |
Phlomis linearis |
Phlomis regelii |
Recordia reitzii |
Stachytarpheta mutabilis |
PubChem | 3515874 |
LOTUS | LTS0000549 |
wikiData | Q105246601 |