[(2S,3R,4R,5S,6S)-6-methyl-2-[[(1S,3R,4S,5R,6R,8R,10S,22S,23S,24S,26R)-4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl]oxy]-4,5-bis[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]oxan-3-yl] decanoate
Internal ID | b5eaf8b5-90ed-4728-9274-5e1fe7779765 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3R,4R,5S,6S)-6-methyl-2-[[(1S,3R,4S,5R,6R,8R,10S,22S,23S,24S,26R)-4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl]oxy]-4,5-bis[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]oxan-3-yl] decanoate |
SMILES (Canonical) | CCCCCCCCCC(=O)OC1C(C(C(OC1OC2C(OC3C(C2OC(=O)CCCCCCCCCC(OC4C(O3)C(C(C(O4)C)O)O)CCCCC)O)C)C)OC5C(C(C(C(O5)C)O)O)O)OC6C(C(C(C(O6)C)O)O)O |
SMILES (Isomeric) | CCCCCCCCCC(=O)O[C@@H]1[C@@H]([C@H]([C@@H](O[C@H]1O[C@H]2[C@@H](O[C@@H]3[C@@H]([C@@H]2OC(=O)CCCCCCCCC[C@@H](O[C@H]4[C@H](O3)[C@H]([C@H]([C@H](O4)C)O)O)CCCCC)O)C)C)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)O)O)O)O[C@H]6[C@@H]([C@@H]([C@H]([C@@H](O6)C)O)O)O |
InChI | InChI=1S/C56H98O23/c1-8-10-12-13-15-19-24-28-36(58)75-51-50(79-53-44(66)41(63)38(60)30(4)69-53)47(76-52-43(65)40(62)37(59)29(3)68-52)33(7)72-56(51)77-46-32(6)71-54-45(67)48(46)74-35(57)27-23-20-17-14-16-18-22-26-34(25-21-11-9-2)73-55-49(78-54)42(64)39(61)31(5)70-55/h29-34,37-56,59-67H,8-28H2,1-7H3/t29-,30-,31+,32-,33-,34-,37-,38-,39-,40+,41+,42-,43+,44+,45+,46-,47-,48-,49+,50+,51+,52-,53-,54-,55-,56-/m0/s1 |
InChI Key | FRUKYYWENNHFFD-NGGINCOXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C56H98O23 |
Molecular Weight | 1139.40 g/mol |
Exact Mass | 1138.64988937 g/mol |
Topological Polar Surface Area (TPSA) | 327.00 Ų |
XlogP | 5.20 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4R,5S,6S)-6-methyl-2-[[(1S,3R,4S,5R,6R,8R,10S,22S,23S,24S,26R)-4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl]oxy]-4,5-bis[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]oxan-3-yl] decanoate 2D Structure of [(2S,3R,4R,5S,6S)-6-methyl-2-[[(1S,3R,4S,5R,6R,8R,10S,22S,23S,24S,26R)-4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl]oxy]-4,5-bis[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]oxan-3-yl] decanoate](https://plantaedb.com/storage/docs/compounds/2023/11/ecdc1020-85e2-11ee-a61c-a780504c00a7.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.61% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.28% | 91.11% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 95.80% | 92.50% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.55% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.07% | 99.17% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 93.80% | 100.00% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 91.27% | 90.24% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.68% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.47% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.71% | 86.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.58% | 97.36% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.12% | 97.25% |
CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 87.09% | 98.57% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.47% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.38% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.71% | 93.56% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 85.60% | 83.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.79% | 94.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.10% | 97.09% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.95% | 95.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.50% | 91.19% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.92% | 96.25% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 82.49% | 92.08% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.77% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.36% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.25% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea pes-caprae |
PubChem | 16735397 |
LOTUS | LTS0081077 |
wikiData | Q105000443 |