1-[6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-6,7-dihydroxy-7-methyl-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylic acid
Internal ID | c0835878-b8aa-4185-ae58-a202709883ac |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | 1-[6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-6,7-dihydroxy-7-methyl-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylic acid |
SMILES (Canonical) | CC1(C(CC2C1C(OC=C2C(=O)O)OC3C(C(C(C(O3)COC(=O)C=CC4=CC(=C(C=C4)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1(C(CC2C1C(OC=C2C(=O)O)OC3C(C(C(C(O3)COC(=O)C=CC4=CC(=C(C=C4)O)O)O)O)O)O)O |
InChI | InChI=1S/C25H30O14/c1-25(35)16(28)7-11-12(22(33)34)8-37-23(18(11)25)39-24-21(32)20(31)19(30)15(38-24)9-36-17(29)5-3-10-2-4-13(26)14(27)6-10/h2-6,8,11,15-16,18-21,23-24,26-28,30-32,35H,7,9H2,1H3,(H,33,34) |
InChI Key | YHZBVXGYEGLXCQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H30O14 |
Molecular Weight | 554.50 g/mol |
Exact Mass | 554.16355563 g/mol |
Topological Polar Surface Area (TPSA) | 233.00 Ų |
XlogP | -1.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.49% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.49% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.41% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.00% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.64% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.15% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.78% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.26% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.11% | 90.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.99% | 90.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.89% | 96.95% |
CHEMBL3194 | P02766 | Transthyretin | 90.81% | 90.71% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.25% | 97.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.69% | 94.45% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.59% | 94.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.57% | 99.17% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 82.72% | 85.31% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.64% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.78% | 92.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.53% | 94.73% |
CHEMBL5028 | O14672 | ADAM10 | 81.28% | 97.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.01% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lippia origanoides |
PubChem | 163042891 |
LOTUS | LTS0143034 |
wikiData | Q105348689 |