(2R,3R,4S,10S)-2,10-bis(3,4-dihydroxyphenyl)-4-[(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-4-[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]-3,5-dihydroxy-3,4-dihydro-2H-chromen-8-yl]-3,5-dihydroxy-3,4,9,10-tetrahydro-2H-pyrano[2,3-h]chromen-8-one
Internal ID | 35341028-30bd-4f6b-8314-290f24b6631e |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | (2R,3R,4S,10S)-2,10-bis(3,4-dihydroxyphenyl)-4-[(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-4-[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]-3,5-dihydroxy-3,4-dihydro-2H-chromen-8-yl]-3,5-dihydroxy-3,4,9,10-tetrahydro-2H-pyrano[2,3-h]chromen-8-one |
SMILES (Canonical) | C1C(C(OC2=C1C(=C(C(=C2)O)C3C(C(OC4=C(C=CC(=C34)O)C5C(C(OC6=C5C(=CC7=C6C(CC(=O)O7)C8=CC(=C(C=C8)O)O)O)C9=CC(=C(C=C9)O)O)O)C1=CC(=C(C=C1)O)O)O)O)C1=CC(=C(C=C1)O)O)O |
SMILES (Isomeric) | C1[C@@H]([C@H](OC2=C1C(=C(C(=C2)O)[C@@H]3[C@H]([C@H](OC4=C(C=CC(=C34)O)[C@@H]5[C@H]([C@H](OC6=C5C(=CC7=C6[C@@H](CC(=O)O7)C8=CC(=C(C=C8)O)O)O)C9=CC(=C(C=C9)O)O)O)C1=CC(=C(C=C1)O)O)O)O)C1=CC(=C(C=C1)O)O)O |
InChI | InChI=1S/C54H44O20/c55-26-6-1-19(11-31(26)60)24-16-40(67)71-39-18-36(65)45-42(48(69)51(74-54(45)41(24)39)21-3-8-28(57)33(62)13-21)23-5-10-30(59)44-46(49(70)52(73-53(23)44)22-4-9-29(58)34(63)14-22)43-35(64)17-38-25(47(43)68)15-37(66)50(72-38)20-2-7-27(56)32(61)12-20/h1-14,17-18,24,37,42,46,48-52,55-66,68-70H,15-16H2/t24-,37-,42-,46-,48+,49+,50+,51+,52+/m0/s1 |
InChI Key | LWBKRPLLBBALDD-DBQMMTMOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C54H44O20 |
Molecular Weight | 1012.90 g/mol |
Exact Mass | 1012.24259379 g/mol |
Topological Polar Surface Area (TPSA) | 357.00 Ų |
XlogP | 4.50 |
There are no found synonyms. |
![2D Structure of (2R,3R,4S,10S)-2,10-bis(3,4-dihydroxyphenyl)-4-[(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-4-[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]-3,5-dihydroxy-3,4-dihydro-2H-chromen-8-yl]-3,5-dihydroxy-3,4,9,10-tetrahydro-2H-pyrano[2,3-h]chromen-8-one 2D Structure of (2R,3R,4S,10S)-2,10-bis(3,4-dihydroxyphenyl)-4-[(2R,3R,4S)-2-(3,4-dihydroxyphenyl)-4-[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]-3,5-dihydroxy-3,4-dihydro-2H-chromen-8-yl]-3,5-dihydroxy-3,4,9,10-tetrahydro-2H-pyrano[2,3-h]chromen-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/eca73800-8621-11ee-ab69-1d80953bce46.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.85% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.74% | 83.82% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.27% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.07% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.88% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.10% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 91.90% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.61% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.59% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.12% | 85.14% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 86.61% | 96.37% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.33% | 91.49% |
CHEMBL2535 | P11166 | Glucose transporter | 86.24% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.92% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.98% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.67% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.02% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kandelia candel |
PubChem | 163016578 |
LOTUS | LTS0015469 |
wikiData | Q105158191 |