methyl (1S,4aR,7R,7aR)-4a-hydroxy-7-methyl-5-oxo-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,6,7,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate
Internal ID | 69d86027-63e3-4e4c-b44e-34086506c04c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1S,4aR,7R,7aR)-4a-hydroxy-7-methyl-5-oxo-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,6,7,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1CC(=O)C2(C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1CC(=O)[C@]2([C@@H]1[C@@H](OC=C2C(=O)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O |
InChI | InChI=1S/C17H24O11/c1-6-3-9(19)17(24)7(14(23)25-2)5-26-15(10(6)17)28-16-13(22)12(21)11(20)8(4-18)27-16/h5-6,8,10-13,15-16,18,20-22,24H,3-4H2,1-2H3/t6-,8-,10+,11-,12+,13-,15+,16+,17-/m1/s1 |
InChI Key | PRZVXHGUJJPSME-OFKRMOSHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H24O11 |
Molecular Weight | 404.40 g/mol |
Exact Mass | 404.13186158 g/mol |
Topological Polar Surface Area (TPSA) | 172.00 Ų |
XlogP | -1.70 |
There are no found synonyms. |
![2D Structure of methyl (1S,4aR,7R,7aR)-4a-hydroxy-7-methyl-5-oxo-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,6,7,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate 2D Structure of methyl (1S,4aR,7R,7aR)-4a-hydroxy-7-methyl-5-oxo-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,6,7,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/ec409230-86df-11ee-b1b1-6710f189873e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.70% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.18% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.10% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.70% | 83.82% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.12% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.80% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.05% | 97.09% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.23% | 91.24% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.41% | 94.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.02% | 92.50% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.00% | 95.83% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.68% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.62% | 90.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.28% | 96.61% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.01% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Junellia seriphioides |
Penstemon centranthifolius |
Penstemon grandiflorus |
Penstemon secundiflorus |
PubChem | 95223075 |
LOTUS | LTS0071259 |
wikiData | Q104402122 |