[6-[2-[5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxochromen-6-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
Internal ID | 99387e8b-d4e3-4422-82ca-09c97984485c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides |
IUPAC Name | [6-[2-[5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxochromen-6-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)OCC2C(C(C(C(O2)OC3C(C(C(OC3C4=C(C5=C(C=C4O)OC(=CC5=O)C6=CC(=C(C=C6)O)OC)O)CO)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C=CC(=O)OCC2C(C(C(C(O2)OC3C(C(C(OC3C4=C(C5=C(C=C4O)OC(=CC5=O)C6=CC(=C(C=C6)O)OC)O)CO)O)O)O)O)O)O |
InChI | InChI=1S/C38H40O19/c1-51-22-9-15(3-6-17(22)40)4-8-27(44)53-14-26-31(46)33(48)35(50)38(56-26)57-37-34(49)30(45)25(13-39)55-36(37)29-20(43)12-24-28(32(29)47)19(42)11-21(54-24)16-5-7-18(41)23(10-16)52-2/h3-12,25-26,30-31,33-41,43,45-50H,13-14H2,1-2H3 |
InChI Key | DJZOTDSGEBENPL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H40O19 |
Molecular Weight | 800.70 g/mol |
Exact Mass | 800.21637904 g/mol |
Topological Polar Surface Area (TPSA) | 301.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.78% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.34% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.18% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.05% | 96.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.61% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.98% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.12% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 93.97% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 93.35% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.59% | 94.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.50% | 86.92% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.49% | 95.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.44% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.65% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.08% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.33% | 99.15% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.29% | 96.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.24% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.62% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.98% | 95.89% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.16% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cucumis sativus |
Oryza sativa |
PubChem | 73829970 |
LOTUS | LTS0133152 |
wikiData | Q104982929 |