Ebuloside
Internal ID | 2fe55e12-0c3f-48f3-88cb-2028746e1a4e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | [(1S,4aS,7R,7aS)-7-methyl-6-oxo-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4a,5,7,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate |
SMILES (Canonical) | CC1C2C(CC1=O)C(=COC2OC(=O)CC(C)C)COC3C(C(C(C(O3)CO)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]2[C@H](CC1=O)C(=CO[C@H]2OC(=O)CC(C)C)CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
InChI | InChI=1S/C21H32O10/c1-9(2)4-15(24)31-20-16-10(3)13(23)5-12(16)11(7-28-20)8-29-21-19(27)18(26)17(25)14(6-22)30-21/h7,9-10,12,14,16-22,25-27H,4-6,8H2,1-3H3/t10-,12+,14+,16+,17+,18-,19+,20-,21+/m0/s1 |
InChI Key | XKQWFBQKSSYGBS-WPHWWJDCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H32O10 |
Molecular Weight | 444.50 g/mol |
Exact Mass | 444.19954721 g/mol |
Topological Polar Surface Area (TPSA) | 152.00 Ų |
XlogP | -0.70 |
103553-93-1 |
(-)-3-Methylbutanoic acid (1S)-4-[(beta-D-glucopyranosyloxy)methyl]-1,4aalpha,5,6,7,7aalpha-hexahydro-7alpha-methyl |
[(1S,4aS,7R,7aS)-7-methyl-6-oxo-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4a,5,7,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate |
SCHEMBL419362 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.81% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.75% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.95% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.52% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.82% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.87% | 86.33% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 86.80% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.42% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.58% | 95.93% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.47% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.22% | 95.56% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.53% | 82.50% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.05% | 85.14% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.87% | 86.92% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.48% | 92.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.19% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sambucus ebulus |
PubChem | 21587051 |
LOTUS | LTS0124346 |
wikiData | Q105329668 |