Ebeinone
Internal ID | 9b5c9887-32a9-469b-a0d7-8c7d91301b23 |
Taxonomy | Organoheterocyclic compounds > Piperidines |
IUPAC Name | (1R,6R,9S,10R,14S,15S,18S,20S,23R,24S)-20-hydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-2(11)-en-17-one |
SMILES (Canonical) | CC1CCC2C(C3=C(CN2C1)C4CC5C(C4CC3)CC(=O)C6C5(CCC(C6)O)C)C |
SMILES (Isomeric) | C[C@@H]1CC[C@H]2[C@@H](C3=C(CN2C1)[C@@H]4C[C@H]5[C@H]([C@@H]4CC3)CC(=O)[C@@H]6[C@@]5(CC[C@@H](C6)O)C)C |
InChI | InChI=1S/C27H41NO2/c1-15-4-7-25-16(2)18-5-6-19-20(22(18)14-28(25)13-15)11-23-21(19)12-26(30)24-10-17(29)8-9-27(23,24)3/h15-17,19-21,23-25,29H,4-14H2,1-3H3/t15-,16-,17+,19-,20-,21+,23+,24-,25+,27-/m1/s1 |
InChI Key | ICSCULPVAJQROK-ILIONMCUSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C27H41NO2 |
Molecular Weight | 411.60 g/mol |
Exact Mass | 411.313729551 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 3.80 |
125409-58-7 |
(1R,6R,9S,10R,14S,15S,18S,20S,23R,24S)-20-hydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacos-2(11)-en-17-one |
DTXSID50154764 |
![2D Structure of Ebeinone 2D Structure of Ebeinone](https://plantaedb.com/storage/docs/compounds/2023/11/ebeinone.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.34% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.92% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.98% | 97.09% |
CHEMBL238 | Q01959 | Dopamine transporter | 92.01% | 95.88% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.59% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.98% | 100.00% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 90.52% | 94.78% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.70% | 89.05% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.02% | 91.11% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.19% | 96.43% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.39% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.57% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.18% | 91.19% |
CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 84.11% | 91.83% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 83.97% | 95.62% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 83.97% | 97.05% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.60% | 93.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.34% | 94.75% |
CHEMBL2581 | P07339 | Cathepsin D | 83.33% | 98.95% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.92% | 93.40% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.36% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.35% | 90.71% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.79% | 91.03% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 81.02% | 95.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.93% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fritillaria ebeiensis |
Fritillaria imperialis |
Fritillaria unibracteata var. wabuensis |
PubChem | 180322 |
LOTUS | LTS0219685 |
wikiData | Q83022080 |